
CAS Number848193-68-0
Synonyms(S)-selisistat; OCZ; S1541_Selleck; (1S)-6-Chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide; cc-651; EX527; EX-527 S-enantiomer; EX-527 (S-enantiomer)
Molecular FormulaC13H13ClN2O
Molecular Weight248.708
Purity98%%
Density1.4±0.1 g/cm3
Boiling Point531.7±38.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 848193-68-0 |
| Catalog No. | 2A-1170931 |
| Chinese Name | Selisistat S-对映体 |
| Synonyms | (S)-selisistat; OCZ; S1541_Selleck; (1S)-6-Chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide; cc-651; EX527; EX-527 S-enantiomer; EX-527 (S-enantiomer) |
| Molecular Formula | C13H13ClN2O |
| Molecular Weight | 248.708 |
| Purity | 98% |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 531.7±38.0 °C at 760 mmHg |
| Storage Condition | -20°C, sealed, dry |
| Application | Selisistat S-enantiomer (EX-527 S-enantiomer) is the S-enantiomer of Selisistat, which can effectively inhibit the activity of SIRT1 with an IC50 value of 123 nM. Selisistat S-enantiomer is much more |
| PubChem ID | 33765675 |
| SMILES | NC(=O)C1CCCc2c1[nH]c1ccc(Cl)cc21 |
| InChI | InChI=1S/C13H13ClN2O/c14-7-4-5-11-10(6-7)8-2-1-3-9(13(15)17)12(8)16-11/h4-6,9,16H,1-3H2,(H2,15,17)/t9-/m0/s1 |
| InChI Key | FUZYTVDVLBBXDL-VIFPVBQESA-N |
| Transport Info | Product name: (1S)-6-chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Potassium tert-butoxymethyltrifluoroborate | 910251-10-4 | 2A-1170922 |
| Potassium 3-trifluoroboratopropionate methyl ester | 1023357-63-2 | 2A-1170924 |
| 2,2-Dimethylpropyltrifluoroborate potassium salt | 1150655-02-9 | 2A-1170925 |
| Potassium cyclohexene-1-trifluoroborate | 1186667-20-8 | 2A-1170928 |
| EX-527 (R-enantioMer) | 848193-69-1 | 2A-1170930 |
| Octanoic acid, 6,8-bis[(phenylMethyl)thio]- | 95809-78-2 | 2A-1170932 |
| Golvatinib (E7050) | 928037-13-2 | 2A-1170933 |
| N-[3-tert-Butyl-1-(quinolin-6-yl)-1H-pyrazol-5-yl]-N'-[2-fluoro-4-[(2-(methylcarbamoyl)pyridin-4-yl)oxy]phenyl]urea | 1020172-07-9 | 2A-1170935 |
| PD0332991 Isethionate | 827022-33-3 | 2A-1170936 |
| LY2835219 | 1231930-82-7 | 2A-1170938 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA