
CAS Number1221-56-3
SynonymsOragrafin Sodium; sodium iopodate; Ipodate sodium salt; Sodium ipodate; Biloptinon; Bilimin; Ipodate sodium; Biloptin; Bilivist
Molecular FormulaC20H24FN3O4
Molecular Weight389.42100
Purity98.00%
Boiling Point579.8ºC at 760 mmHg
Melting Point303-304° (decompn with evolution of iodine)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1221-56-3 |
| Catalog No. | 2A-9012475 |
| Chinese Name | 碘泊酸钠 |
| Synonyms | Oragrafin Sodium; sodium iopodate; Ipodate sodium salt; Sodium ipodate; Biloptinon; Bilimin; Ipodate sodium; Biloptin; Bilivist |
| Molecular Formula | C20H24FN3O4 |
| Molecular Weight | 389.42100 |
| Purity | 98.00 |
| Boiling Point | 579.8ºC at 760 mmHg |
| Melting Point | 303-304° (decompn with evolution of iodine) |
| HTC | 2925290090 |
| SMILES | CN(C)C=Nc1c(I)cc(I)c(CCC(=O)O)c1I.[Na] |
| InChI | InChI=1S/C12H13I3N2O2.Na/c1-17(2)6-16-12-9(14)5-8(13)7(11(12)15)3-4-10(18)19;/h5-6H,3-4H2,1-2H3,(H,18,19);/q;+1/p-1 |
| InChI Key | HYUJOXHHFWZNAA-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2925290090 other imines and their derivatives; salts thereof. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Polymer Intermediates | ||
|---|---|---|
| Pentaerythritol tetranitrate | 78-11-5 | 2A-9011920 |
| Prinoxodan | 111786-07-3 | 2A-9012123 |
| Seratrodast | 112665-43-7 | 2A-9012424 |
| Siguazodan | 115344-47-3 | 2A-9012437 |
| Siguazodan | 99591-83-0 | 2A-9012438 |
| Tiodazosin | 66969-81-1 | 2A-9012736 |
| Valspodar | 121584-18-7 | 2A-9012911 |
| 2,4-/2,6-Toluene diisocyanate mixture | 26471-62-5 | 2A-9013198 |
| 2-methoxyethyl acrylate | 3121-61-7 | 2A-9013333 |
| Ammonium iodate | 13446-09-8 | 2A-9013704 |
| Browse all Polymer Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA