CAS Number26471-62-5
Synonyms2,6-Toluene diisocyanate; 2,4-diisocyanatotoluene; EINECS 247-722-4; 2,6-Toluene diisocyanate,mixture of; 20 percent,mixture of; 80 percent,diisocyanatotoluene; Tolylene Diisocyanate; 2,4-toluene diisocyanate,80 percent,2,6-toluene diisocyanate,20 percent,mixture of; Tolylene Diisocyanate,2,4; MFCD01778251; 2,4-Toluene diisocyanate; 2,4-Sulfonitrophenol NV; 2,4-toluene diisocyanate,2,6-toluene diisocyanate,mixture of; Toluene Diisocyanate
Molecular Formula(NCO)2C6H3CH3
Molecular Weight174.16
Purity99%
Density1.1±0.1 g/cm3
Boiling Point247 °C/1013 hPa
Melting Point12-14 °C
Appearanceliquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 26471-62-5 |
| Catalog No. | 2A-9013198 |
| Chinese Name | 甲苯二异氰酸酯 |
| Synonyms | 2,6-Toluene diisocyanate; 2,4-diisocyanatotoluene; EINECS 247-722-4; 2,6-Toluene diisocyanate,mixture of; 20 percent,mixture of; 80 percent,diisocyanatotoluene; Tolylene Diisocyanate; 2,4-toluene diisocyanate,80 percent,2,6-toluene diisocyanate,20 percent,mixture of; Tolylene Diisocyanate,2,4; MFCD01778251; 2,4-Toluene diisocyanate; 2,4-Sulfonitrophenol NV; 2,4-toluene diisocyanate,2,6-toluene diisocyanate,mixture of; Toluene Diisocyanate |
| Molecular Formula | (NCO)2C6H3CH3 |
| Molecular Weight | 174.16 |
| Purity | 99 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 247 °C/1013 hPa |
| Melting Point | 12-14 °C |
| Appearance | liquid |
| Water Solubility | Miscible: ether, benzene, acetone |
| Storage Condition | The warehouse is ventilated and dried at low tempe |
| Packaging | II |
| HTC | 2929101000 |
| MDL Number | MFCD00002011 |
| SMILES | N(=C=O)c1c(ccc(c1)N=C=O)C |
| InChI | 1S/C9H6N2O2/c1-7-2-3-8(10-5-12)4-9(7)11-6-13/h2-4H,1H3 |
| InChI Key | DVKJHBMWWAPEIU-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352118 |
| Hazard Symbols | 6.1(a) |
| MSDS | msds/13198_1_26471_62_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. Minimum tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2929101000. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Polymer Intermediates | ||
|---|---|---|
| Siguazodan | 115344-47-3 | 2A-9012437 |
| Siguazodan | 99591-83-0 | 2A-9012438 |
| Sodiun lopodats | 1221-56-3 | 2A-9012475 |
| Tiodazosin | 66969-81-1 | 2A-9012736 |
| Valspodar | 121584-18-7 | 2A-9012911 |
| 2-methoxyethyl acrylate | 3121-61-7 | 2A-9013333 |
| Ammonium iodate | 13446-09-8 | 2A-9013704 |
| Anhydrous soda | 497-19-8 | 2A-9013728 |
| Barium iodate | 10567-69-8 | 2A-9013785 |
| Bismuthiodate | 13702-39-1 | 2A-9013864 |
| Browse all Polymer Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS