
CAS Number14203-24-8
Synonyms1,3-Cyclopentanedione,2-bromo; N-bromosuccinimide; 2-bromo-cyclopentane-1,3-dione; 2-bromocyclopentan-1,3-dione; bromocyclopentanedione; 2-Bromo-1,3-cyclopentanedione; 2-bromo-1,3-cyclopentadione; 2-Brom-cyclopentan-1,3-dion
Molecular FormulaC5H5BrO2
Molecular Weight177
Purity96+%
Density1.842±0.06 g/cm3(Predicted)
Boiling Point259.0±40.0 °C(Predicted)
Melting Point197-199DEºC
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14203-24-8 |
| Catalog No. | 2A-1120482 |
| Chinese Name | 2-溴-1,3-环戊二酮 |
| Synonyms | 1,3-Cyclopentanedione,2-bromo; N-bromosuccinimide; 2-bromo-cyclopentane-1,3-dione; 2-bromocyclopentan-1,3-dione; bromocyclopentanedione; 2-Bromo-1,3-cyclopentanedione; 2-bromo-1,3-cyclopentadione; 2-Brom-cyclopentan-1,3-dion |
| Molecular Formula | C5H5BrO2 |
| Molecular Weight | 177 |
| Purity | 96+ |
| Density | 1.842±0.06 g/cm3(Predicted) |
| Boiling Point | 259.0±40.0 °C(Predicted) |
| Melting Point | 197-199DEºC |
| Storage Condition | 2-8°C, inert atmosphere |
| EINECS | 0 |
| HTC | 2914700090 |
| UN(IATA) | 0 |
| PubChem ID | 8693774 |
| SMILES | O=C1CCC(=O)C1Br |
| InChI | InChI=1S/C5H5BrO2/c6-5-3(7)1-2-4(5)8/h5H,1-2H2 |
| InChI Key | ROZCQYLERXSBBC-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-BROMO-N-PROPYLBENZENESULFONAMIDE | 951883-92-4 | 2A-0120447 |
| 2-BROMO-N1,N1-DIMETHYLBENZENE-1,4-DIAMINE | 860444-64-0 | 2A-0120448 |
| 2-BROMOACETIC ANHYDRIDE | 13094-51-4 | 2A-2120452 |
| 2-BROMOCYCLOBUTANONE | 1192-01-4 | 2A-0120479 |
| 2-BROMOCYCLOHEPTANONE | 766-65-4 | 2A-0120480 |
| 2-BROMOINDAN-1-ONE | 1175-27-5 | 2A-0120496 |
| 2-BROMOISOPHTHALIC ACID | 22433-91-6 | 2A-0120501 |
| 2-BROMOISOPHTHALONITRILE | 22433-90-5 | 2A-0120502 |
| 2-BROMONAPHTHALEN-1-OL | 771-15-3 | 2A-0120514 |
| 2-BROMONONANOIC ACID | 2623-83-8 | 2A-0120519 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA