
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13094-51-4 |
| Catalog No. | 2A-2120452 |
| Chinese Name | 溴代乙酸酐 |
| Synonyms | Bromoacetic anhydride; MFCD00045041; (2-bromoacetyl) 2-bromoacetate |
| Molecular Formula | C4H4Br2O3 |
| Molecular Weight | 259.88 |
| Purity | 96+ |
| Density | 2.1±0.1 g/cm3 |
| Boiling Point | 226.2±25.0 °C at 760 mmHg |
| Melting Point | 31-36 °C(lit.) |
| Appearance | solid |
| Storage Condition | room temperature, inert gas |
| EINECS | 0 |
| HTC | 2917190090 |
| UN(IATA) | 0 |
| PubChem ID | 6248928 |
| SMILES | O=C(CBr)OC(=O)CBr |
| InChI | InChI=1S/C4H4Br2O3/c5-1-3(7)9-4(8)2-6/h1-2H2 |
| InChI Key | FUKOTTQGWQVMQB-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-BROMO-N-PHENYLACETAMIDE | 5326-87-4 | 2A-0120444 |
| 2-BROMO-N-PHENYLBUTANAMIDE | 21486-48-6 | 2A-0120445 |
| 2-BROMO-N-PHENYLPROPANAMIDE | 94347-34-9 | 2A-0120446 |
| 2-BROMO-N-PROPYLBENZENESULFONAMIDE | 951883-92-4 | 2A-0120447 |
| 2-BROMO-N1,N1-DIMETHYLBENZENE-1,4-DIAMINE | 860444-64-0 | 2A-0120448 |
| 2-BROMOCYCLOBUTANONE | 1192-01-4 | 2A-0120479 |
| 2-BROMOCYCLOHEPTANONE | 766-65-4 | 2A-0120480 |
| 2-BROMOCYCLOPENTANE-1,3-DIONE | 14203-24-8 | 2A-1120482 |
| 2-BROMOINDAN-1-ONE | 1175-27-5 | 2A-0120496 |
| 2-BROMOISOPHTHALIC ACID | 22433-91-6 | 2A-0120501 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA