
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1192-01-4 |
| Catalog No. | 2A-0120479 |
| Chinese Name | 2-溴环丁烷-1-酮 |
| Synonyms | 2-Bromocyclobutanone; 2-Bromcyclobutanon; bromocyclobutanone; 2-bromo-cyclobutanon |
| Molecular Formula | C4H5BrO |
| Molecular Weight | 148.98600 |
| Purity | 96+ |
| Density | 1.82g/cm3 |
| Boiling Point | 168.3ºC at 760 mmHg |
| Storage Condition | 2-8°C |
| EINECS | 0 |
| HTC | 2914700090 |
| UN(IATA) | 0 |
| PubChem ID | 38210261 |
| InChI | InChI=1S/C4H5BrO/c5-3-1-2-4(3)6/h3H,1-2H2 |
| InChI Key | XQZZIZVMMMRELO-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-BROMO-N-PHENYLBUTANAMIDE | 21486-48-6 | 2A-0120445 |
| 2-BROMO-N-PHENYLPROPANAMIDE | 94347-34-9 | 2A-0120446 |
| 2-BROMO-N-PROPYLBENZENESULFONAMIDE | 951883-92-4 | 2A-0120447 |
| 2-BROMO-N1,N1-DIMETHYLBENZENE-1,4-DIAMINE | 860444-64-0 | 2A-0120448 |
| 2-BROMOACETIC ANHYDRIDE | 13094-51-4 | 2A-2120452 |
| 2-BROMOCYCLOHEPTANONE | 766-65-4 | 2A-0120480 |
| 2-BROMOCYCLOPENTANE-1,3-DIONE | 14203-24-8 | 2A-1120482 |
| 2-BROMOINDAN-1-ONE | 1175-27-5 | 2A-0120496 |
| 2-BROMOISOPHTHALIC ACID | 22433-91-6 | 2A-0120501 |
| 2-BROMOISOPHTHALONITRILE | 22433-90-5 | 2A-0120502 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA