
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5326-87-4 |
| Catalog No. | 2A-0120444 |
| Chinese Name | 2-溴-N-苯乙酰胺 |
| Synonyms | Monobromoacetanilide; 2-Bromo-N-phenylacetamide; 2-bromo-n-phenyl-acetamide |
| Molecular Formula | C8H8BrNO |
| Molecular Weight | 214.06 |
| Purity | 96+ |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 353.3±25.0 °C at 760 mmHg |
| Storage Condition | This product should be sealed and stored away from |
| EINECS | 0 |
| HTC | 2924299090 |
| UN(IATA) | 0 |
| PubChem ID | 329785680 |
| MDL Number | MFCD00462518 |
| SMILES | O=C(CBr)Nc1ccccc1 |
| InChI | InChI=1S/C8H8BrNO/c9-6-8(11)10-7-4-2-1-3-5-7/h1-5H,6H2,(H,10,11) |
| InChI Key | DCPLOIFDMMEBQZ-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-BROMO-N-METHYL-4-NITROANILINE | 6911-88-2 | 2A-0120436 |
| 2-BROMO-N-METHYLBENZAMIDE | 61436-88-2 | 2A-0120440 |
| 2-BROMO-N-METHYLBENZENESULFONAMIDE | 98192-14-4 | 2A-0120441 |
| 2-BROMO-N-METHYLISONICOTINAMIDE | 337536-01-3 | 2A-0120442 |
| 2-BROMO-N-PENTYLBENZENESULFONAMIDE | 951883-99-1 | 2A-0120443 |
| 2-BROMO-N-PHENYLBUTANAMIDE | 21486-48-6 | 2A-0120445 |
| 2-BROMO-N-PHENYLPROPANAMIDE | 94347-34-9 | 2A-0120446 |
| 2-BROMO-N-PROPYLBENZENESULFONAMIDE | 951883-92-4 | 2A-0120447 |
| 2-BROMO-N1,N1-DIMETHYLBENZENE-1,4-DIAMINE | 860444-64-0 | 2A-0120448 |
| 2-BROMOACETIC ANHYDRIDE | 13094-51-4 | 2A-2120452 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA