
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 771-15-3 |
| Catalog No. | 2A-0120514 |
| Chinese Name | 2-溴-1-萘酚 |
| Synonyms | 2-Bromo-1-naphthol; 2-Bromo-naphthalen-1-ol |
| Molecular Formula | C10H7BrO |
| Molecular Weight | 223.07 |
| Purity | 96+ |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 313.7±15.0 °C at 760 mmHg |
| Melting Point | 44-46ºC |
| Storage Condition | room temperature |
| EINECS | 0 |
| HTC | 2908199090 |
| UN(IATA) | 0 |
| PubChem ID | 10250876 |
| SMILES | Oc1c(Br)ccc2ccccc12 |
| InChI | InChI=1S/C10H7BrO/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6,12H |
| InChI Key | LOHOSHDZQVKDPS-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-BROMOCYCLOHEPTANONE | 766-65-4 | 2A-0120480 |
| 2-BROMOCYCLOPENTANE-1,3-DIONE | 14203-24-8 | 2A-1120482 |
| 2-BROMOINDAN-1-ONE | 1175-27-5 | 2A-0120496 |
| 2-BROMOISOPHTHALIC ACID | 22433-91-6 | 2A-0120501 |
| 2-BROMOISOPHTHALONITRILE | 22433-90-5 | 2A-0120502 |
| 2-BROMONONANOIC ACID | 2623-83-8 | 2A-0120519 |
| 2,6-Difluorophenethylamine | 17291-90-6 | 2A-2120527 |
| 2-BROMOPROPANAMIDE | 5875-25-2 | 2A-0120534 |
| 2-BROMOPYRIMIDIN-5-OL | 1240621-87-7 | 2A-0120546 |
| 2-BROMOQUINOLIN-3-AMINE | 17127-83-2 | 2A-0120549 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA