
CAS Number31828-71-4
Synonymsmexitil; Cirumimeru; EINECS 250-825-7; ko1173; Katen; MFCD00216024; Ritalmex; 1-(2,6-Dimethylphenoxy)-2-propanamine; Mexilitene; Olzoron; MEXILITINE HCL; Toy
Molecular FormulaC11H17O1N1
Molecular Weight179.26
Purity98.00%
Density0.979 g/cm3
Boiling Point271.5ºC at 760 mmHg
Melting Point203-205ºC
Appearancepowder | white
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 31828-71-4 |
| Catalog No. | 2A-9011429 |
| Chinese Name | 美西律 |
| Synonyms | mexitil; Cirumimeru; EINECS 250-825-7; ko1173; Katen; MFCD00216024; Ritalmex; 1-(2,6-Dimethylphenoxy)-2-propanamine; Mexilitene; Olzoron; MEXILITINE HCL; Toy |
| Molecular Formula | C11H17O1N1 |
| Molecular Weight | 179.26 |
| Purity | 98.00 |
| Density | 0.979 g/cm3 |
| Boiling Point | 271.5ºC at 760 mmHg |
| Melting Point | 203-205ºC |
| Appearance | powder | white |
| Water Solubility | ethanol: 50 mg/mL |
| Storage Condition | 2-8°C |
| Packaging | III |
| HTC | 2922299090 |
| MDL Number | MFCD00792471 |
| SMILES | Cc1cccc(C)c1OCC(C)N |
| InChI | InChI=1S/C11H17NO.ClH/c1-8-5-4-6-9(2)11(8)13-7-10(3)12;/h4-6,10H,7,12H2,1-3H3;1H |
| InChI Key | VLPIATFUUWWMKC-UHFFFAOYSA-N |
| Hazard Symbols | 6.1(b) |
| MSDS | msds/11429_1_31828_71_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Metrifudil | 23707-33-7 | 2A-9011419 |
| Metynodiol | 23163-42-0 | 2A-9011424 |
| Metyrapone | 54-36-4 | 2A-9011425 |
| Mevindrin | 7786-34-7 | 2A-9011427 |
| Mexafylline | 80294-25-3 | 2A-9011428 |
| Mexrenoate potassium | 43169-54-6 | 2A-9011430 |
| Mezlocillin acid | 51481-65-3 | 2A-9011431 |
| Mezlocillin sodium | 59798-30-0 | 2A-9011432 |
| Mianserine hydrochloride | 21535-47-7 | 2A-9011433 |
| Mibefradil dihydrochloride | 116666-63-8 | 2A-9011434 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA