
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 122647-31-8 |
| Catalog No. | 2A-9010884 |
| Chinese Name | 伊布利特 |
| Synonyms | MFCD01715410 |
| Molecular Formula | C20H36N2O3S |
| Molecular Weight | 442.61 |
| Purity | ≥98 (HPLC) |
| Density | 1.099g/cm3 |
| Boiling Point | 522.4ºC at 760mmHg |
| Appearance | solid |
| Storage Condition | 2-8°C |
| Application | Ibutilide (U70226E free base) is an action potential-prolonging antiarrhythmic effect and an effective blocker of rapidly activated delayed rectifier potassium current (IKr) in AT-1 cells [1]. |
| PubChem ID | 329815470 |
| MDL Number | MFCD01715410 |
| SMILES | OC(=O)\C=C\C(O)=O.CCCCCCCN(CC)CCCC(O)c1ccc(NS(C)(=O)=O)cc1.CCCCCCCN(CC)CCCC(O)c2ccc(NS(C)(=O)=O)cc2 |
| InChI | 1S/2C20H36N2O3S.C4H4O4/c2*1-4-6-7-8-9-16-22(5-2)17-10-11-20(23)18-12-14-19(15-13-18)21-26(3,24)25;5-3(6)1-2-4(7)8/h2*12-15,20-21,23H,4-11,16-17H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;;2-1+ |
| InChI Key | PCIOHQNIRPWFMV-WXXKFALUSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/10884_1_122647_31_8.pdf |
| Transport Info | Product name: Iblit |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Hyoscyamine sulfate | 620-61-1 | 2A-9010876 |
| Hypocrellin A | 77029-83-5 | 2A-9010878 |
| Hypocrellin B | 123940-54-5 | 2A-9010879 |
| Ibandronic acid | 114084-78-5 | 2A-9010880 |
| Ibopamine | 66195-31-1 | 2A-9010882 |
| Ichthammol | 8029-68-3 | 2A-9010886 |
| Icopezil | 145508-78-7 | 2A-9010887 |
| Idazoxan | 79944-58-4 | 2A-9010891 |
| Idazoxan hydrochloride | 79944-56-2 | 2A-9010892 |
| Idebenone | 58186-27-9 | 2A-9010893 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA