
CAS Number123940-54-5
Synonyms3-Acetyl-6,11-dihydroxy-4,8,9,13-tetramethoxy-2-methyl-1H-cyclohepta[ghi]perylene-5,12-dione; Hypocrellin B
Molecular FormulaC30H24O9
Molecular Weight528.52
Purity98.00%
Density1.5±0.1 g/cm3
Boiling Point893.8±65.0 °C at 760 mmHg
Melting Point261-263℃
AppearanceYellow crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 123940-54-5 |
| Catalog No. | 2A-9010879 |
| Chinese Name | 竹红菌乙素 |
| Synonyms | 3-Acetyl-6,11-dihydroxy-4,8,9,13-tetramethoxy-2-methyl-1H-cyclohepta[ghi]perylene-5,12-dione; Hypocrellin B |
| Molecular Formula | C30H24O9 |
| Molecular Weight | 528.52 |
| Purity | 98.00 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 893.8±65.0 °C at 760 mmHg |
| Melting Point | 261-263℃ |
| Appearance | Yellow crystal |
| Storage Condition | 2-8℃, protected from light, sealed |
| Application | Hypocrellin B is a pigment isolated from the fungi Hypocrella bambusae and Shiraia bambusicola and is an apoptosis inducer. Hypocrellin B is a photosensitizer used in photodynamic therapy of cancer. H |
| MDL Number | MFCD00467741 |
| SMILES | COc1c(O)c2c(=O)cc(OC)c3c4c(OC)cc(=O)c5c(O)c(OC)c6c(c(c1CC(C)=C6C(C)=O)c23)c54 |
| InChI | InChI=1S/C30H24O9/c1-10-7-13-20-19-12(26(33)28(35)29(13)38-5)8-15(36-3)22-16(37-4)9-14(32)21(24(19)22)25-23(20)17(10)18(11(2)31)30(39-6)27(25)34/h8-9,32,34H,7H2,1-6H3 |
| InChI Key | SBMXTMAIKRQSQE-UHFFFAOYSA-N |
| MSDS | msds/10879_1_123940_54_5.pdf |
| Transport Info | Product Name: Hypocrellin B |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Hydrogenated castor oil | 8001-78-3 | 2A-9010869 |
| Hyodeoxycholic acid | 83-49-8 | 2A-9010874 |
| Hyoscyamine | 101-31-5 | 2A-9010875 |
| Hyoscyamine sulfate | 620-61-1 | 2A-9010876 |
| Hypocrellin A | 77029-83-5 | 2A-9010878 |
| Ibandronic acid | 114084-78-5 | 2A-9010880 |
| Ibopamine | 66195-31-1 | 2A-9010882 |
| Ibutilide | 122647-31-8 | 2A-9010884 |
| Ichthammol | 8029-68-3 | 2A-9010886 |
| Icopezil | 145508-78-7 | 2A-9010887 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA