
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 192939-46-1 |
| Catalog No. | 2A-9010437 |
| Chinese Name | 希美加群 |
| Synonyms | ximelagatran; ximelagatra; Exanta; H 376-95; [3H]-Ximelagatran; Ximelagatran (JAN/USAN/INN); Exanta (TN); Exarta; Ximelagatran [USAN:INN] |
| Molecular Formula | C24H35N5O5 |
| Molecular Weight | 473.57 |
| Purity | ≥98 (HPLC) |
| Density | 1.4±0.1 g/cm3 |
| Appearance | powder |
| Storage Condition | -20°C, sealed, dry |
| Application | Ximelagatran (H 376/95) is an orally active thrombin inhibitor that selectively and competitively inhibits free and clot-bound thrombin. Ximelagatran is also an anticoagulant drug with rapid onset of |
| SMILES | N/C(C1=CC=C(CNC([C@@H]2CCN2C([C@@H](C3CCCCC3)NCC(OCC)=O)=O)=O)C=C1)=N/O |
| InChI | 1S/C24H35N5O5/c1-2-34-20(30)15-26-21(17-6-4-3-5-7-17)24(32)29-13-12-19(29)23(31)27-14-16-8-10-18(11-9-16)22(25)28-33/h8-11,17,19,21,26,33H,2-7,12-15H2,1H3,(H2,25,28)(H,27,31)/t19-,21+/m0/s1 |
| InChI Key | ZXIBCJHYVWYIKI-PZJWPPBQSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 51111800 |
| MSDS | msds/10437_1_192939_46_1.pdf |
| Transport Info | Product Name: Ximelagatran |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Eucatropine | 100-91-4 | 2A-9010430 |
| Euphorbiasteroid | 28649-59-4 | 2A-9010432 |
| Everolimus | 159351-69-6 | 2A-9010434 |
| Exalamide | 53370-90-4 | 2A-9010435 |
| Exametazime | 105613-48-7 | 2A-9010436 |
| Exaprolol | 55837-19-9 | 2A-9010438 |
| Extractum fructus phyllanthus | 2A-301523 | 2A-9010440 |
| Extractum radix rauvolfia | 2A-301524 | 2A-9010441 |
| Ezetimibe | 163222-33-1 | 2A-9010442 |
| Famciclovir | 104227-87-4 | 2A-9010443 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA