
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 159351-69-6 |
| Catalog No. | 2A-9010434 |
| Chinese Name | 依维莫司 |
| Synonyms | SDZRAD; Certican; Zortress; Afinitor; RAD-001; CERTICAN(R); 42-O-(2-Hydroxyethyl)-rapamycin; Everolimus; Certica |
| Molecular Formula | C53H83NO14 |
| Molecular Weight | 958.22 |
| Purity | 98 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 998.7±75.0 °C at 760 mmHg |
| Appearance | liquid |
| Water Solubility | Soluble in dimethysulfoxide,ethanol and chloroform |
| Storage Condition | −20°C |
| Application | Everolimus (RAD001) is a potent mTOR inhibitor that binds to FKBP-12 to produce an immunosuppressive complex. |
| PubChem ID | 329798983 |
| MDL Number | MFCD00929329 |
| SMILES | N21[C@@H](CCCC2)C(=O)O[C@@H](CC(=O)[C@@H](\C=C(\[C@H]([C@H](C(=O)[C@@H](C[C@@H](\C=C\C=C\C=C(\[C@H](C[C@H]4O[C@]([C@@H](CC4)C)(C(=O)C1=O)O)OC)/C)C)C)OC)O)/C)C)[C@@H](C[C@H]3C[C@H]([C@@H](CC3)OCCO)OC)C |
| InChI | 1S/C53H83NO14/c1-32-16-12-11-13-17-33(2)44(63-8)30-40-21-19-38(7)53(62,68-40)50(59)51(60)54-23-15-14-18-41(54)52(61)67-45(35(4)28-39-20-22-43(66-25-24-55)46(29-39)64-9)31-42(56)34(3)27-37(6)48(58)49(65-10)47(57)36(5)26-32/h11-13,16-17,27,32,34-36,38-41,43-46,48-49,55,58,62H,14-15,18-26,28-31H2,1-10H3/b13-11+,16-12+,33-17+,37-27+/t32-,34-,35-,36-,38-,39+,40+,41+,43-,44+,45+,46-,48-,49+,53-/m1/s1 |
| InChI Key | HKVAMNSJSFKALM-GKUWKFKPSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/10434_1_159351_69_6.pdf |
| Transport Info | Product Name: Everolimus |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Etorphine | 14521-96-1 | 2A-9010427 |
| Etretinate | 54350-48-0 | 2A-0202305 |
| Etrofolan | 2631-40-5 | 2A-9010429 |
| Eucatropine | 100-91-4 | 2A-9010430 |
| Euphorbiasteroid | 28649-59-4 | 2A-9010432 |
| Exalamide | 53370-90-4 | 2A-9010435 |
| Exametazime | 105613-48-7 | 2A-9010436 |
| Exanta | 192939-46-1 | 2A-9010437 |
| Exaprolol | 55837-19-9 | 2A-9010438 |
| Extractum fructus phyllanthus | 2A-301523 | 2A-9010440 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA