
CAS Number54350-48-0
Synonymsethyl (all-E)-9-(4-methyoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate; 2,4,6,8-Nonatetraenoic acid, 9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethyl-, ethyl ester; Retinoid; 9-(4-methoxy-2,3,6-trimethyl-phenyl)-3,7-dimethyl-nona-2,4,6,8-tetraen-1-oic acid ethyl ester; Ethyl etrinoate; Ro 10-9359; Etretinatum [INN-Latin]; Etretinato; ethyl (2E,4E,6E,8E)-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate; Etretinatum; ethyl all-trans-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethyl-2,4,6,8-nonatetraenoate; EINECS 259-119-3; MFCD00866624; Ethyl 9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethyl-2,4,6,8-nonatetraenoate; Etretinato [INN-Spanish]; Tegison
Molecular FormulaC23H30O3
Molecular Weight354.48
Purity98%
Density1.0±0.1 g/cm3
Boiling Point506.4±38.0 °C at 760 mmHg
Melting Point104-105ºC
Appearancecrystalline solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 54350-48-0 |
| Catalog No. | 2A-0202305 |
| Chinese Name | 依曲替酯 |
| Synonyms | ethyl (all-E)-9-(4-methyoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate; 2,4,6,8-Nonatetraenoic acid, 9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethyl-, ethyl ester; Retinoid; 9-(4-methoxy-2,3,6-trimethyl-phenyl)-3,7-dimethyl-nona-2,4,6,8-tetraen-1-oic acid ethyl ester; Ethyl etrinoate; Ro 10-9359; Etretinatum [INN-Latin]; Etretinato; ethyl (2E,4E,6E,8E)-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate; Etretinatum; ethyl all-trans-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethyl-2,4,6,8-nonatetraenoate; EINECS 259-119-3; MFCD00866624; Ethyl 9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethyl-2,4,6,8-nonatetraenoate; Etretinato [INN-Spanish]; Tegison |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.48 |
| Purity | 98 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 506.4±38.0 °C at 760 mmHg |
| Melting Point | 104-105ºC |
| Appearance | crystalline solid |
| Storage Condition | Amber Vial, -20°C Freezer |
| Application | Etretinate (Ro 10-9359) is a drug used to treat psoriasis and has been replaced by acitretin in clinical use. |
| MDL Number | MFCD00866624 |
| SMILES | O(C)c1c(c(c(c(c1)C)\C=C\C(=C\C=C\C(=C\C(=O)OCC)\C)\C)C)C |
| InChI | 1S/C23H30O3/c1-8-26-23(24)14-17(3)11-9-10-16(2)12-13-21-18(4)15-22(25-7)20(6)19(21)5/h9-15H,8H2,1-7H3/b11-9+,13-12+,16-10+,17-14+ |
| InChI Key | HQMNCQVAMBCHCO-DJRRULDNSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/10428_1_54350_48_0.pdf |
| Transport Info | Product name: Icitretinate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Etofylline clofibrate | 54504-70-0 | 2A-9010420 |
| Etomidate | 33125-97-2 | 2A-9010421 |
| Etomoxir | 82258-36-4 | 2A-9010422 |
| Etonogestrel | 54048-10-1 | 2A-9010423 |
| Etorphine | 14521-96-1 | 2A-9010427 |
| Etrofolan | 2631-40-5 | 2A-9010429 |
| Eucatropine | 100-91-4 | 2A-9010430 |
| Euphorbiasteroid | 28649-59-4 | 2A-9010432 |
| Everolimus | 159351-69-6 | 2A-9010434 |
| Exalamide | 53370-90-4 | 2A-9010435 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA