
CAS Number72-43-5
Synonyms1-methoxy-4-[2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]benzene; Maralate; 2,2-bis(p-methoxy phenyl)-1,1,1-trichloroethane; MFCD00000803; 1,1'-(2,2,2-trichloroethane-1,1-diyl)bis(4-methoxybenzene); Methoxcide; Metox; [3H]-Methoxychlor; EINECS 200-779-9; 1,1,1-trichloro-2,2-bis(p-methoxyphenyl)-ethane; 1,1-di-(p-methoxyphenyl)-2,2,2-trichloroethane; 1,1,1-trichloro-2,2-bis(4-methoxyphenyl)ethane; DMDT; Marlate; Methoxy-DDT; p,p'-Methoxychlor; 1,1'-(2,2,2-trichloroethylidene)bis[4-methoxybenzene]; Dimethoxy-DDT
Molecular FormulaC16H15Cl3O2
Molecular Weight345.65
Purity98%
Density1.4 g/cm3
Boiling Pointgreater than or equal to 100ºC.
Melting Point86-88 °C (lit.)
AppearanceColorless to light yellow crystals with a unique odor
EINECS200-779-9
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 72-43-5 |
| Catalog No. | 2A-9010098 |
| Chinese Name | 甲氧滴滴涕 |
| Synonyms | 1-methoxy-4-[2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]benzene; Maralate; 2,2-bis(p-methoxy phenyl)-1,1,1-trichloroethane; MFCD00000803; 1,1'-(2,2,2-trichloroethane-1,1-diyl)bis(4-methoxybenzene); Methoxcide; Metox; [3H]-Methoxychlor; EINECS 200-779-9; 1,1,1-trichloro-2,2-bis(p-methoxyphenyl)-ethane; 1,1-di-(p-methoxyphenyl)-2,2,2-trichloroethane; 1,1,1-trichloro-2,2-bis(4-methoxyphenyl)ethane; DMDT; Marlate; Methoxy-DDT; p,p'-Methoxychlor; 1,1'-(2,2,2-trichloroethylidene)bis[4-methoxybenzene]; Dimethoxy-DDT |
| Molecular Formula | C16H15Cl3O2 |
| Molecular Weight | 345.65 |
| Purity | 98 |
| Density | 1.4 g/cm3 |
| Boiling Point | greater than or equal to 100ºC. |
| Melting Point | 86-88 °C (lit.) |
| Appearance | Colorless to light yellow crystals with a unique odor |
| Storage Condition | Store in a cool, ventilated and dry place, and do |
| EINECS | 200-779-9 |
| HTC | 2909309011 |
| UN(IATA) | UN 无资料 |
| PubChem ID | 329755307 |
| MDL Number | MFCD00000803 |
| SMILES | COc1ccc(cc1)C(c2ccc(OC)cc2)C(Cl)(Cl)Cl |
| InChI | 1S/C16H15Cl3O2/c1-20-13-7-3-11(4-8-13)15(16(17,18)19)12-5-9-14(21-2)10-6-12/h3-10,15H,1-2H3 |
| InChI Key | IAKOZHOLGAGEJT-UHFFFAOYSA-N |
| Beilstein/REAXYS | 2057367 |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/10098_1_72_43_5.pdf |
| Tax Rebate | 0.0% |
| Supervision | S. Import and export pesticide registration certificate |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Diacerein | 13739-02-1 | 2A-9010091 |
| Diacetazotol | 83-63-6 | 2A-9010092 |
| Diacetolol | 28197-69-5 | 2A-9010093 |
| Diacetoxyscirpenol | 2270-40-8 | 2A-9010094 |
| Diallate | 2303-16-4 | 2A-9010097 |
| Diaveridine | 5355-16-8 | 2A-9010099 |
| Diaveridine hydrochloride | 2507-23-5 | 2A-9010100 |
| Diazoxide | 364-98-7 | 2A-9010102 |
| Dibekacin | 58580-55-5 | 2A-9010103 |
| Dibenzthione | 350-12-9 | 2A-9010104 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA