
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 112398-08-0 |
| Catalog No. | 2A-9009995 |
| Chinese Name | 达诺沙星 |
| Synonyms | danofloxacin |
| Molecular Formula | C19H20FN3O3 |
| Molecular Weight | 357.38 |
| Purity | 98.5 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 569.3±50.0 °C at 760 mmHg |
| Melting Point | 268-272ºC |
| Appearance | colorless powder |
| Water Solubility | Soluble in water, acetic acid and DMSO |
| Storage Condition | Store at 2-8℃, filled with argon |
| Application | Danofloxacin is an orally active third-generation fluoroquinolone antibacterial agent with broad-spectrum activity against most Gram-negative and Gram-positive bacteria, Mycoplasma and Chlamydial spec |
| PubChem ID | 329754635 |
| MDL Number | MFCD00864910 |
| SMILES | CN1C[C@@H]2C[C@H]1CN2c3cc4N(C=C(C(O)=O)C(=O)c4cc3F)C5CC5 |
| InChI | 1S/C19H20FN3O3/c1-21-7-12-4-11(21)8-22(12)17-6-16-13(5-15(17)20)18(24)14(19(25)26)9-23(16)10-2-3-10/h5-6,9-12H,2-4,7-8H2,1H3,(H,25,26)/t11-,12-/m0/s1 |
| InChI Key | QMLVECGLEOSESV-RYUDHWBXSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/9995_1_112398_08_0.pdf |
| Transport Info | Product name: Danofloxacin |
| Related Products in API & Advanced Intermediates | ||
|---|---|---|
| Colchicine | 64-86-8 | 2A-9009900 |
| Colchicine salicylate | 2A-300984 | 2A-9009901 |
| Colistin sulphate | 1264-72-8 | 2A-9009903 |
| Cyclosporine | 79217-60-0 | 2A-9009960 |
| Cyclosporine A | 59865-13-3 | 2A-9009961 |
| Dexamethasone dipropionate | 2A-301156 | 2A-9010073 |
| Dexsotalol | 30236-32-9 | 2A-9010084 |
| Dexverapamil | 38321-02-7 | 2A-9010090 |
| Diclofenac diethylamine | 78213-16-8 | 2A-9010121 |
| Diclofenac potassium | 15307-81-0 | 2A-9010122 |
| Browse all API & Advanced Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA