
CAS Number37577-28-9
SynonymsEINECS 238-900-2; dl-phenylpropanolamine; d-NOREPHEDRINE BASE; (1R,2S)-2-Amino-1-phenyl-1-propanol hydrochloride (1:1); PHENYLPROPANOLAMINEBASE; d-Phenylpropanolamine; dl-NOREPHEDRINE BASE; MFCD00064411; Benzenemethanol, α-[(1S)-1-aminoethyl]-, (αR)-, hydrochloride (1:1); dl-propadrine
Molecular FormulaC9H13NO
Molecular Weight187.667
Purity98%
Density1.071g/cm3
Boiling Point288.1ºC at 760mmHg
Melting Point51-54ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 37577-28-9 |
| Catalog No. | 2A-9009979 |
| Chinese Name | 左旋去甲麻黄碱 |
| Synonyms | EINECS 238-900-2; dl-phenylpropanolamine; d-NOREPHEDRINE BASE; (1R,2S)-2-Amino-1-phenyl-1-propanol hydrochloride (1:1); PHENYLPROPANOLAMINEBASE; d-Phenylpropanolamine; dl-NOREPHEDRINE BASE; MFCD00064411; Benzenemethanol, α-[(1S)-1-aminoethyl]-, (αR)-, hydrochloride (1:1); dl-propadrine |
| Molecular Formula | C9H13NO |
| Molecular Weight | 187.667 |
| Purity | 98 |
| Density | 1.071g/cm3 |
| Boiling Point | 288.1ºC at 760mmHg |
| Melting Point | 51-54ºC |
| HTC | 2922199090 |
| SMILES | CC(N)C(O)c1ccccc1 |
| InChI | InChI=1S/C9H13NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9,11H,10H2,1H3/t7-,9-/m1/s1 |
| InChI Key | DLNKOYKMWOXYQA-VXNVDRBHSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Alkaloids | ||
|---|---|---|
| Betaxolol | 63659-18-7 | 2A-9009386 |
| Bulleyaconitine A | 107668-79-1 | 2A-9009481 |
| Caffeine | 58-08-2 | 2A-9009535 |
| Chelerythrine cloride | 3895-92-9 | 2A-9009714 |
| Cinchonidine sulfate | 549-56-4 | 2A-9009800 |
| D-(+)-Norephedrine hydrochloride | 40626-29-7 | 2A-9009980 |
| Deacetyltaxol | 78432-77-6 | 2A-9010017 |
| Dehydromonocrotaline | 23291-96-5 | 2A-9010033 |
| Demecolcine | 477-30-5 | 2A-9010043 |
| Dihydroergotamine | 11032-41-0 | 2A-9010153 |
| Browse all Alkaloids products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA