
CAS Number55268-75-2
SynonymsEINECS 259-560-1; cefuroxim; U1troxim; Ketocef; Cefuroxime; Biocidin; cefaloxime; Cephuroxime; MFCD00864991; CXM; Biofuroksym; EkLxirrm
Molecular FormulaC16H16N4O8S
Molecular Weight424.39
Purity98%
Density1.8±0.1 g/cm3
Melting Point171.5-173°C
AppearanceWhite crystal, [α] +63.7° (C=1.0, 0.2mol/L phosphate buffer pH=7). UV maximum absorption (pH=6 phosp
EINECS259-560-1
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 55268-75-2 |
| Catalog No. | 2A-9009684 |
| Chinese Name | 头孢呋肟 |
| Synonyms | EINECS 259-560-1; cefuroxim; U1troxim; Ketocef; Cefuroxime; Biocidin; cefaloxime; Cephuroxime; MFCD00864991; CXM; Biofuroksym; EkLxirrm |
| Molecular Formula | C16H16N4O8S |
| Molecular Weight | 424.39 |
| Purity | 98 |
| Density | 1.8±0.1 g/cm3 |
| Melting Point | 171.5-173°C |
| Appearance | White crystal, [α] +63.7° (C=1.0, 0.2mol/L phosphate buffer pH=7). UV maximum absorption (pH=6 phosp |
| Storage Condition | 2-8°C, dry |
| Application | Cefuroxime is an orally active second-generation cephalosporin antibiotic (antibiotic) with increased stability against lactase (β-lactamase). Cefuroxime has broad-spectrum inhibitory activity and is |
| EINECS | 259-560-1 |
| PubChem ID | 329754904 |
| MDL Number | MFCD00864889 |
| SMILES | [H][C@]12SCC(COC(N)=O)=C(N1C(=O)[C@H]2NC(=O)\C(=N/OC)c3ccco3)C(O)=O |
| InChI | 1S/C16H16N4O8S/c1-26-19-9(8-3-2-4-27-8)12(21)18-10-13(22)20-11(15(23)24)7(5-28-16(17)25)6-29-14(10)20/h2-4,10,14H,5-6H2,1H3,(H2,17,25)(H,18,21)(H,23,24)/b19-9-/t10-,14-/m1/s1 |
| InChI Key | JFPVXVDWJQMJEE-IZRZKJBUSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/9684_1_55268_75_2.pdf |
| Transport Info | Product Name: Cefuroxime Acid |
| Related Products in API & Advanced Intermediates | ||
|---|---|---|
| Cefotaxime sodium | 64485-93-4 | 2A-9009652 |
| Ceftazidime | 72558-82-8 | 2A-9009670 |
| Ceftazidime dihydrochloride | 73547-70-3 | 2A-9009671 |
| Ceftriaxone sodium | 104376-79-6 | 2A-9009681 |
| Ceftriaxone sodium | 73384-59-5 | 2A-9009682 |
| Cefuroxime sodium | 56238-63-2 | 2A-9009685 |
| Celecoxib | 169590-42-5 | 2A-9009688 |
| Cephalexin | 15686-71-2 | 2A-9009695 |
| Cephalexin monhydrochloride | 23325-78-2 | 2A-9009696 |
| Cerivastatin | 145599-86-6 | 2A-9009700 |
| Browse all API & Advanced Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA