
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 12001-79-5 |
| Catalog No. | 2A-9093982 |
| Chinese Name | 维生素k |
| Synonyms | Vitamin K |
| Molecular Formula | C31H46O2 |
| Molecular Weight | 450.70 |
| Purity | 85 |
| Density | 0.963g/cm3 |
| Boiling Point | 140-145 °C/0.0013 hPa |
| Melting Point | -20 °C |
| Appearance | liquid |
| Storage Condition | 2-8°C |
| Application | Vitamin K is a group of fat-soluble vitamins that play important roles in many proteins in the body, such as clotting factors, osteocalcin and matrix-Gla protein. |
| PubChem ID | 5148 |
| MDL Number | MFCD00214063 |
| SMILES | O=C1c2c(cccc2)C(=O)C(=C1C\C=C(\CCCC(CCCC(CCCC(C)C)C)C)/C)C |
| InChI | 1S/C31H46O2/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)20-21-27-26(6)30(32)28-18-7-8-19-29(28)31(27)33/h7-8,18-20,22-24H,9-17,21H2,1-6H3/b25-20+ |
| InChI Key | MBWXNTAXLNYFJB-LKUDQCMESA-N |
| UNSPSC | 12352115 |
| MSDS | msds/93982_1_12001_79_5.pdf |
| Transport Info | Product name: VitaminK |
| Related Products in Nutritional Ingredients | ||
|---|---|---|
| INOSITOL | 6917-35-7 | 2A-9093719 |
| Diclazepam | 2894-68-0 | 2A-9093819 |
| HYDROXOCOBALAMIN HYDROCHLORIDE | 58288-50-9 | 2A-9093859 |
| A-METHYL-L-TRYPTOPHAN | 153-91-3 | 2A-9093947 |
| CHITOSAN OLIGOSACCHARIDE LACTATE | 148411-57-8 | 2A-9093958 |
| EGG LECITHIN | 97281-47-5 | 2A-9093991 |
| Glucosamine 2KCL | 2A-175667 | 2A-9094024 |
| N-[4-[3-[2-Amino-4-(formylamino)-1,6-dihydro-6-oxo-5-pyrimidinyl]-3-oxopropyl]benzoyl]-L-glutamic Acid | 1644286-35-0 | 2A-9094051 |
| NARINGENIN | 67604-48-2 | 2A-9094075 |
| Rutin trihydrate | 250249-75-3 | 2A-9094095 |
| Browse all Nutritional Ingredients products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA