
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5959-39-7 |
| Catalog No. | 2A-9093693 |
| Chinese Name | 2-amino-4,6-dichlorophenol hydrochloride |
| Synonyms | EINECS 227-725-7; 2-Amino-4,6-dichlorophenol hydrochloride; 2-Amino-4,6-dichlor-phenol,Hydrochlorid |
| Molecular Formula | C6H6O1N1Cl1F2 |
| Molecular Weight | 181.57 |
| Purity | 98.00% |
| Boiling Point | 286.5ºC at 760 mmHg |
| HTC | 2922299090 |
| PubChem ID | 24525654 |
| MDL Number | MFCD29060467 |
| SMILES | Cl.Nc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C6H5Cl2NO.ClH/c7-3-1-4(8)6(10)5(9)2-3;/h1-2,10H,9H2;1H |
| InChI Key | KERIIOGUYVYCCE-UHFFFAOYSA-N |
| MSDS | msds/93693_1_5959_39_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| MK-1439 | 1338225-97-0 | 2A-9093684 |
| oxyphenisatine di(acetate) | 115-33-3 | 2A-9093685 |
| Isocromil | 57009-15-1 | 2A-9093687 |
| 4-(CyclopropylaMino)butanoic acid ethyl ester | 813429-65-1 | 2A-9093688 |
| Ethanethioic acid, S-(tetrahydro-1-oxido-3-thienyl) ester, (1R-cis)- (9CI) | 120788-03-6 | 2A-9093691 |
| Aluminum nitride (AlN), solid soln. with silicon carbide (SiC) | 71243-74-8 | 2A-9093695 |
| SAMARIUM CHLORIDE | 10361-82-7 | 2A-9093697 |
| NEODYMIUM CHLORIDE | 10024-93-8 | 2A-9093698 |
| 2-chloro-4-nitrophenylmaltotrioside | 118291-90-0 | 2A-9093701 |
| (±)-JQ1 | 1268524-69-1 | 2A-9093702 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA