
CAS Number118291-90-0
Synonyms2-Chloro-4-nitrophenyl α-D-glucopyranosyl-(1->4)-α-D-glucopyranosyl-(1->4)-α-D-glucopyranoside; 2-Chloro-4-Nitrophenyl Maltotrioside; 2-Chloro-4-nitrophenyl a-D-maltotrioside
Molecular FormulaC24H34ClNO18
Molecular Weight659.98
Purity≥95 (HPLC)%
Density1.8±0.1 g/cm3
Boiling Point976.0±65.0 °C at 760 mmHg
Appearancepowder or crystals
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 118291-90-0 |
| Catalog No. | 2A-9093701 |
| Chinese Name | 2-氯-4-硝基苯基-α-D-吡喃麦芽三糖苷 |
| Synonyms | 2-Chloro-4-nitrophenyl α-D-glucopyranosyl-(1->4)-α-D-glucopyranosyl-(1->4)-α-D-glucopyranoside; 2-Chloro-4-Nitrophenyl Maltotrioside; 2-Chloro-4-nitrophenyl a-D-maltotrioside |
| Molecular Formula | C24H34ClNO18 |
| Molecular Weight | 659.98 |
| Purity | ≥95 (HPLC) |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 976.0±65.0 °C at 760 mmHg |
| Appearance | powder or crystals |
| Storage Condition | 20°C, inert gas |
| Application | G3-CNP is an alpha-amylase substrate. The absorbance of the G3-CNP cleavage product 2-chloro-4-nitrophenol is measured at 405nm and can be used to detect enzyme activity [1]. |
| PubChem ID | 329770276 |
| MDL Number | MFCD11045274 |
| SMILES | OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](O[C@@H]2CO)O[C@H]3[C@H](O)[C@@H](O)[C@H](O[C@@H]3CO)Oc4ccc(cc4Cl)[N+]([O-])=O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | 1S/C24H34ClNO18/c25-8-3-7(26(37)38)1-2-9(8)39-22-18(35)15(32)20(11(5-28)41-22)44-24-19(36)16(33)21(12(6-29)42-24)43-23-17(34)14(31)13(30)10(4-27)40-23/h1-3,10-24,27-36H,4-6H2/t10-,11-,12-,13-,14+,15-,16-,17-,18-,19-,20-,21-,22+,23-,24-/m1/s1 |
| InChI Key | KMYYNUOXSFGLNX-XFNLHOCBSA-N |
| NACRES Code | NA.32 |
| UNSPSC | 12352204 |
| MSDS | msds/93701_1_118291_90_0.pdf |
| Transport Info | Product name: 2-Chloro-4-nitrophenyl-α-D-maltotrioside |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethanethioic acid, S-(tetrahydro-1-oxido-3-thienyl) ester, (1R-cis)- (9CI) | 120788-03-6 | 2A-9093691 |
| 2-amino-4,6-dichlorophenol hydrochloride | 5959-39-7 | 2A-9093693 |
| Aluminum nitride (AlN), solid soln. with silicon carbide (SiC) | 71243-74-8 | 2A-9093695 |
| SAMARIUM CHLORIDE | 10361-82-7 | 2A-9093697 |
| NEODYMIUM CHLORIDE | 10024-93-8 | 2A-9093698 |
| (±)-JQ1 | 1268524-69-1 | 2A-9093702 |
| (+)-JQ1 | 1268524-70-4 | 2A-9093703 |
| PHENOXYETHYL PROPIONATE | 23495-12-7 | 2A-9093705 |
| THALLIUM | 7440-28-0 | 2A-9093706 |
| titanium(4+) acetate | 13057-42-6 | 2A-9093707 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA