
CAS Number27013-91-8
Synonymsα-Hederin; Alpha-hederin; glycosidel-e1; UNII:4H15F0GLV2; sapindosidea; HELIXIN; nepalin2; dipsacobioside; Hederoside B; koronaroside A; hederosidec; akebosidestc; taurosidee; A-HEDERIN; SAPINDOSIDE A; HEDERIN; alpha-Hederin
Molecular FormulaC41H66O12
Molecular Weight750.96
Density1.3±0.1 g/cm3
Boiling Point849.6±65.0 °C at 760 mmHg
Melting Point215ºC (dec.)
Appearancewhite powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 27013-91-8 |
| Catalog No. | 2A-9093128 |
| Chinese Name | α-常春藤皂苷 |
| Synonyms | α-Hederin; Alpha-hederin; glycosidel-e1; UNII:4H15F0GLV2; sapindosidea; HELIXIN; nepalin2; dipsacobioside; Hederoside B; koronaroside A; hederosidec; akebosidestc; taurosidee; A-HEDERIN; SAPINDOSIDE A; HEDERIN; alpha-Hederin |
| Molecular Formula | C41H66O12 |
| Molecular Weight | 750.96 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 849.6±65.0 °C at 760 mmHg |
| Melting Point | 215ºC (dec.) |
| Appearance | white powder |
| Storage Condition | 2~8℃ |
| Application | Alpha-hederin is a water-soluble pentacyclic triterpene saponin that has many chemical properties, such as antispasmodic, anthelmintic, and inhibiting cell growth. |
| PubChem ID | 11146 |
| SMILES | CC1OC(OC2C(OC3CCC4(C)C(CCC5(C)C4CC=C4C6CC(C)(C)CCC6(C(=O)O)CCC45C)C3(C)CO)OCC(O)C2O)C(O)C(O)C1O |
| InChI | InChI=1S/C41H66O12/c1-21-28(44)30(46)31(47)33(51-21)53-32-29(45)24(43)19-50-34(32)52-27-11-12-37(4)25(38(27,5)20-42)10-13-40(7)26(37)9-8-22-23-18-36(2,3)14-16-41(23,35(48)49)17-15-39(22,40)6/h8,21,23-34,42-47H,9-20H2,1-7H3,(H,48,49)/t21-,23-,24-,25+,26+,27-,28-,29-,30+,31+,32+,33-,34-,37-,38-,39+,40+,41-/m0/s1 |
| InChI Key | KEOITPILCOILGM-JAVOQYPHSA-N |
| Transport Info | Product name: α-Ivy saponin |
| Related Products in Botanical Reference Standards | ||
|---|---|---|
| METHYL-ALPHA-D-MANNOPYRANOSIDE | 617-04-9 | 2A-9092844 |
| Methyl α-D-Galactopyranoside | 93302-26-2 | 2A-9093057 |
| Bilirubin Di-acyl-b-D-glucuronide | 17459-92-6 | 2A-9093091 |
| CYCLOASTRAGENOL | 78574-94-4 | 2A-9093119 |
| 23-HYDROXYBETULINIC ACID | 85999-40-2 | 2A-9093123 |
| Hederacoside C | 14216-03-6 | 2A-9093129 |
| XANTHOHUMOL | 6754-58-1 | 2A-9093136 |
| TanshinoneIIA | 69659-80-9 | 2A-9093154 |
| SOYASAPONIN III | 55304-02-4 | 2A-9093175 |
| Soyasaponin V | 114590-20-4 | 2A-9093176 |
| Browse all Botanical Reference Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA