
CAS Number878672-00-5
SynonymsRDEA594; {[5-Bromo-4-(4-cyclopropyl-1-naphthyl)-4H-1,2,4-triazol-3-yl]sulfanyl}acetic acid; CS-1389; 2-[[5-bromo-4-(4-cyclopropylnaphthalen-1-yl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid; Lesinurad
Molecular FormulaC17H14BrN3O2S
Molecular Weight404.28
Purity≥98 (HPLC)%
Density1.72±0.1 g/cm3
Boiling Point643.7±65.0 °C at 760 mmHg
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 878672-00-5 |
| Catalog No. | 2A-9092742 |
| Chinese Name | 雷西纳德 |
| Synonyms | RDEA594; {[5-Bromo-4-(4-cyclopropyl-1-naphthyl)-4H-1,2,4-triazol-3-yl]sulfanyl}acetic acid; CS-1389; 2-[[5-bromo-4-(4-cyclopropylnaphthalen-1-yl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid; Lesinurad |
| Molecular Formula | C17H14BrN3O2S |
| Molecular Weight | 404.28 |
| Purity | ≥98 (HPLC) |
| Density | 1.72±0.1 g/cm3 |
| Boiling Point | 643.7±65.0 °C at 760 mmHg |
| Appearance | powder |
| Water Solubility | Insuluble (1.5E-4 g/L) (25 ºC) |
| Storage Condition | -20°C |
| Application | Lesinurad is a URAT1 and OAT inhibitor that acts as a substrate for the renal transporters OAT1 and OAT3 with Km values of 0.85 and 2 μM, respectively. |
| PubChem ID | 329825493 |
| MDL Number | MFCD22572730 |
| SMILES | BrC1=NN=C(SCC(O)=O)N1C2=C3C(C=CC=C3)=C(C4CC4)C=C2 |
| InChI | 1S/C17H14BrN3O2S/c18-16-19-20-17(24-9-15(22)23)21(16)14-8-7-11(10-5-6-10)12-3-1-2-4-13(12)14/h1-4,7-8,10H,5-6,9H2,(H,22,23) |
| InChI Key | FGQFOYHRJSUHMR-UHFFFAOYSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/92742_1_878672_00_5.pdf |
| Transport Info | Product Name: Lesinurad |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| GSK1349572 sodiuM salt | 1051375-19-9 | 2A-9092734 |
| KP 103 | 164650-44-6 | 2A-9092735 |
| Unii-4U07F515lg | 496775-62-3 | 2A-9092736 |
| Faldaprevir | 801283-95-4 | 2A-9092739 |
| VX-770 | 873054-44-5 | 2A-9092741 |
| Intedanib | 656247-17-5 | 2A-9092743 |
| MK-3102 | 1226781-44-7 | 2A-9092744 |
| RESIQUIMOD | 144875-48-9 | 2A-9092747 |
| AZD-9291 | 1421373-65-0 | 2A-9092748 |
| 3-(1-Biphenyl-4-ylMethyl-3-ethoxycarbonyl-1-butylcarbaMoyl)propionate-3'-Methyl-2'-(pentanoyl(2'-(tetrazol-5-ylate)biphenyl-4'-ylMethyl)aMino)butyrate | 936623-90-4 | 2A-9092749 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA