CAS Number3653-48-3
Synonymssodium 4-chloro-2-methylphenoxyacetate; Dikoteks; sodium 2-(4-chloro-2-methylphenoxy)acetate; 2-methy-4-chlorophenoxyacetic acid,sodium salt; 2-methyl-4-chlorophenoxyacetic acid,sodium salt; sodium 2-methyl-4-chlorophenoxyacetate; Dicotex; Chwastox; Dikotex; EINECS 222-895-9; MCPA sodium; 4-Chloro-2-methylphenoxyacetic acid sodium salt; MCPA sodium salt; sodium 4-chloro-o-tolyloxyacetate; Estermine; sodium (4-chloro-2-methylphenoxy)acetate; Phenoxylene; sodium,2-(4-chloro-2-methylphenoxy)acetate; Chwastoks
Molecular FormulaC9H8ClNaO3
Molecular Weight222.605
Purity98.00%
Boiling Point327ºC at 760mmHg
Melting Point118-119ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3653-48-3 |
| Catalog No. | 2A-9008994 |
| Chinese Name | (4-氯-2-甲基苯氧基)乙酸钠盐 |
| Synonyms | sodium 4-chloro-2-methylphenoxyacetate; Dikoteks; sodium 2-(4-chloro-2-methylphenoxy)acetate; 2-methy-4-chlorophenoxyacetic acid,sodium salt; 2-methyl-4-chlorophenoxyacetic acid,sodium salt; sodium 2-methyl-4-chlorophenoxyacetate; Dicotex; Chwastox; Dikotex; EINECS 222-895-9; MCPA sodium; 4-Chloro-2-methylphenoxyacetic acid sodium salt; MCPA sodium salt; sodium 4-chloro-o-tolyloxyacetate; Estermine; sodium (4-chloro-2-methylphenoxy)acetate; Phenoxylene; sodium,2-(4-chloro-2-methylphenoxy)acetate; Chwastoks |
| Molecular Formula | C9H8ClNaO3 |
| Molecular Weight | 222.605 |
| Purity | 98.00 |
| Boiling Point | 327ºC at 760mmHg |
| Melting Point | 118-119ºC |
| Storage Condition | The warehouse is ventilated and dried at low tempe |
| HTC | 2918990090 |
| MDL Number | MFCD00044436 |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C9H9ClO3.Na/c1-6-4-7(10)2-3-8(6)13-5-9(11)12;/h2-4H,5H2,1H3,(H,11,12);/q;+1/p-1 |
| InChI Key | STAPBGVGYWCRTF-UHFFFAOYSA-M |
| MSDS | msds/8994_1_3653_48_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Morpholinosydnonimine | 33876-97-0 | 2A-9008987 |
| 4-(2-Amino-1-hydroxy-ethyl)phenol | 104-14-3 | 2A-9008988 |
| 4',7-Dihydroxyisoflavone | 486-66-8 | 2A-9008990 |
| 4-Aminobenzoic acid isobuty ester | 94-14-4 | 2A-9008992 |
| 4-Aminobutyric | 56-12-2 | 2A-9008993 |
| 4-Ethylmercurithiobenzenesulfonic acid | 5964-24-9 | 2A-9008995 |
| 4-Methyl-6,7-bis(sulfoxy)-2H-1-benzopyran-2-one,disodium salt,trihydrate | 29334-07-4 | 2A-9008997 |
| 5,7-Dihydroxyflavanone | 68745-38-0 | 2A-9008998 |
| 5-Alpha-androstan-3-betaï¼17-beta-diol | 571-20-0 | 2A-9008999 |
| 5Alpha-androstane-3alphaï¼17beta-diol | 1852-53-5 | 2A-9009000 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS