
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 97678-95-0 |
| Catalog No. | 2A-9088751 |
| Chinese Name | 5-(4-(1-丁基)苯基)-5-氧戊酸 |
| Molecular Formula | C22H21O4N2Cl1S1 |
| Molecular Weight | 444.94 |
| Density | 1.075g/cm3 |
| Boiling Point | 433.3ºC at 760 mmHg |
| Melting Point | 100-103ºC |
| HTC | 2918300090 |
| MDL Number | MFCD28137610 |
| SMILES | CCCCc1ccc(C(=O)CCCC(=O)O)cc1 |
| InChI Key | QUBYDYBBXCCCEA-UHFFFAOYSA-N |
| MSDS | msds/88751_1_97678_95_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(4-tert-Butylphenyl)-4-oxobutyricacid | 35288-08-5 | 2A-9088743 |
| N-(4-Fluoro-benzylidene)benzenesulfonamide | 260556-09-0 | 2A-9088745 |
| 3-(4-tert-Butylphenyl)-3-oxo-propionicacidethylester | 101498-88-8 | 2A-9088746 |
| 3-(4-tert-Butylphenyl)-3-oxo-propionicacidmethylester | 200280-57-5 | 2A-9088748 |
| (4-Fluorobenzylidene)carbamicacidcyclohexylester | 681260-41-3 | 2A-9088749 |
| 5-(4-tert-Butylphenyl)-5-oxovalericacid | 97692-66-5 | 2A-9088752 |
| 2-tert-Butylsulfanylbenzoicacid | 7611-60-1 | 2A-9088755 |
| 2-(tert-Butylsulfonyl)benzoicacid | 5293-55-0 | 2A-9088757 |
| 2-(Carboxymethyl)-4-nitrobenzoicacid | 39585-32-5 | 2A-0202083 |
| 2-(2-Chlorobenzoyl)-3-oxo-butyricacidmethylester | 78181-03-0 | 2A-9088761 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA