
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 35288-08-5 |
| Catalog No. | 2A-9088743 |
| Chinese Name | 4-(4-叔丁基苯基)-4-氧丁酸 |
| Synonyms | ZINC02579954 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29100 |
| Boiling Point | 402.6ºC at 760mmHg |
| Melting Point | 122-125ºC |
| HTC | 2918300090 |
| SMILES | CC(C)(C)c1ccc(C(=O)CCC(=O)O)cc1 |
| InChI | InChI=1S/C14H18O3/c1-14(2,3)11-6-4-10(5-7-11)12(15)8-9-13(16)17/h4-7H,8-9H2,1-3H3,(H,16,17)/p-1 |
| InChI Key | XJHBTHNAMOUNRQ-UHFFFAOYSA-N |
| MSDS | msds/88743_1_35288_08_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-tert-Butoxy-2-isocyanatopropionicacidmethylester | 565461-21-4 | 2A-9088735 |
| 3-(4-tert-Butoxyphenyl)-2-isocyanatopropionicacidmethylester | 808764-19-4 | 2A-9088737 |
| 2-(4-Fluorobenzyl)acetoaceticacidethylester | 88023-07-8 | 2A-9088738 |
| tert-Butyl3-isothiocyanatopropionate | 172422-02-5 | 2A-9088739 |
| 4-(4-tert-Butylphenoxymethyl)benzoicacid | 132991-24-3 | 2A-9088741 |
| N-(4-Fluoro-benzylidene)benzenesulfonamide | 260556-09-0 | 2A-9088745 |
| 3-(4-tert-Butylphenyl)-3-oxo-propionicacidethylester | 101498-88-8 | 2A-9088746 |
| 3-(4-tert-Butylphenyl)-3-oxo-propionicacidmethylester | 200280-57-5 | 2A-9088748 |
| (4-Fluorobenzylidene)carbamicacidcyclohexylester | 681260-41-3 | 2A-9088749 |
| 5-(4-(1-Butyl)phenyl)-5-oxovalericacid | 97678-95-0 | 2A-9088751 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA