CAS Number101498-88-8
SynonymsMFCD03424822; ethyl 4-tert-butylbenzoylacetate; Benzenepropanoic acid, 4-(1,1-dimethylethyl)-β-oxo-, ethyl ester; 4-t-Butylbenzoylessigsaeure-ethylester; Ethyl 3-[4-(2-methyl-2-propanyl)phenyl]-3-oxopropanoate; AC-7795; ETHYL 3-(4-TERT-BUTYLPHENYL)-3-OXOPROPANOATE; p-tert-butylbenzoylacetic ester
Molecular FormulaC18H24N4O2
Molecular Weight328.418
Density1.0±0.1 g/cm3
Boiling Point335.1±25.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 101498-88-8 |
| Catalog No. | 2A-9088746 |
| Chinese Name | 3-(4-叔丁基苯基)-3-氧丙酸乙酯 |
| Synonyms | MFCD03424822; ethyl 4-tert-butylbenzoylacetate; Benzenepropanoic acid, 4-(1,1-dimethylethyl)-β-oxo-, ethyl ester; 4-t-Butylbenzoylessigsaeure-ethylester; Ethyl 3-[4-(2-methyl-2-propanyl)phenyl]-3-oxopropanoate; AC-7795; ETHYL 3-(4-TERT-BUTYLPHENYL)-3-OXOPROPANOATE; p-tert-butylbenzoylacetic ester |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.418 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 335.1±25.0 °C at 760 mmHg |
| HTC | 2918300090 |
| MDL Number | MFCD02669728 |
| SMILES | CCOC(=O)CC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI Key | AEGOOHDAUMBYHG-UHFFFAOYSA-N |
| MSDS | msds/88746_1_101498_88_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(4-Fluorobenzyl)acetoaceticacidethylester | 88023-07-8 | 2A-9088738 |
| tert-Butyl3-isothiocyanatopropionate | 172422-02-5 | 2A-9088739 |
| 4-(4-tert-Butylphenoxymethyl)benzoicacid | 132991-24-3 | 2A-9088741 |
| 4-(4-tert-Butylphenyl)-4-oxobutyricacid | 35288-08-5 | 2A-9088743 |
| N-(4-Fluoro-benzylidene)benzenesulfonamide | 260556-09-0 | 2A-9088745 |
| 3-(4-tert-Butylphenyl)-3-oxo-propionicacidmethylester | 200280-57-5 | 2A-9088748 |
| (4-Fluorobenzylidene)carbamicacidcyclohexylester | 681260-41-3 | 2A-9088749 |
| 5-(4-(1-Butyl)phenyl)-5-oxovalericacid | 97678-95-0 | 2A-9088751 |
| 5-(4-tert-Butylphenyl)-5-oxovalericacid | 97692-66-5 | 2A-9088752 |
| 2-tert-Butylsulfanylbenzoicacid | 7611-60-1 | 2A-9088755 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS