
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5690-24-4 |
| Catalog No. | 2A-9087195 |
| Chinese Name | 1,4,5,8-萘四甲酰基二酰亚胺 |
| Synonyms | EINECS 227-159-0; Benzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone |
| Molecular Formula | C14H6O4N2 |
| Molecular Weight | 266.21 |
| Density | 1.666g/cm3 |
| Boiling Point | 702.8ºC at 760mmHg |
| Appearance | Solid;Light yellow to Brown powder to crystal |
| Storage Condition | Store at room temperature, away from light, in a c |
| HTC | 2933990090 |
| MDL Number | MFCD00047649 |
| SMILES | O=C1NC(=O)c2ccc3c4c(ccc1c24)C(=O)NC3=O |
| InChI | InChI=1S/C14H6N2O4/c17-11-5-1-2-6-10-8(14(20)16-12(6)18)4-3-7(9(5)10)13(19)15-11/h1-4H,(H,15,17,19)(H,16,18,20) |
| InChI Key | BODUWJSFPLUDMP-UHFFFAOYSA-N |
| MSDS | msds/87195_1_5690_24_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Sodiumisovalerate | 539-66-2 | 2A-9087183 |
| 2-Chloro-5-fluoroisonicotinicAcid | 884494-74-0 | 2A-9087184 |
| 2-Amino-1-(4-nitro-phenyl)-ethanonehydrochloride | 5425-81-0 | 2A-9087186 |
| Sodium8-chloronaphthalene-1-sulfonate | 5439-85-0 | 2A-9087189 |
| Methyl2-Hydroxy-5-methoxybenzoate | 2905-82-0 | 2A-9087191 |
| 4-(Methylsulfonamido)benzoicAcid | 7151-76-0 | 2A-9087196 |
| 4-(Methylsulfonylamino)benzylamineHydrochloride | 128263-66-1 | 2A-9087197 |
| 1,7-Dimethylnaphthalene | 575-37-1 | 2A-9087198 |
| 2-Chloro-4-nitrobenzenediazoniumnaphthalene-2-sulfonate | 6035-19-4 | 2A-9087201 |
| 1-Isopropylnaphthalene | 6158-45-8 | 2A-9087203 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA