
CAS Number5425-81-0
Synonyms2-amino-1-(4-nitrophenyl)ethan-1-one hydrochloride; MFCD00025591; Ethanone, 2-amino-1-(4-nitrophenyl)-, hydrochloride (1:1); 2-Amino-1-(4-nitrophenyl)ethanone hydrochloride (1:1)
Molecular FormulaC8H10N2O3
Molecular Weight182.18
Density1.32g/cm3
Boiling Point339.1ºC at 760 mmHg
Melting Point134ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5425-81-0 |
| Catalog No. | 2A-9087186 |
| Chinese Name | 2-氨基-1-(4-硝基-苯)-乙酮盐酸盐 |
| Synonyms | 2-amino-1-(4-nitrophenyl)ethan-1-one hydrochloride; MFCD00025591; Ethanone, 2-amino-1-(4-nitrophenyl)-, hydrochloride (1:1); 2-Amino-1-(4-nitrophenyl)ethanone hydrochloride (1:1) |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 |
| Density | 1.32g/cm3 |
| Boiling Point | 339.1ºC at 760 mmHg |
| Melting Point | 134ºC |
| Storage Condition | room temperature, dry |
| HTC | 2922399090 |
| MDL Number | MFCD00182654 |
| SMILES | Cl.NCC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C8H8N2O3.Cl/c9-5-8(11)6-1-3-7(4-2-6)10(12)13;/h1-4H,5,9H2; |
| InChI Key | UJBOVJRECBNSDI-UHFFFAOYSA-N |
| MSDS | msds/87186_1_5425_81_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,2,3,4,5,6,7,8-Octahydrophenanthrene | 5325-97-3 | 2A-9087177 |
| 1,2,5,6-Dibenzanthracene | 53-70-3 | 2A-9087180 |
| 2-Methoxy-6-nitrobenzoicAcid | 53967-73-0 | 2A-9087182 |
| Sodiumisovalerate | 539-66-2 | 2A-9087183 |
| 2-Chloro-5-fluoroisonicotinicAcid | 884494-74-0 | 2A-9087184 |
| Sodium8-chloronaphthalene-1-sulfonate | 5439-85-0 | 2A-9087189 |
| Methyl2-Hydroxy-5-methoxybenzoate | 2905-82-0 | 2A-9087191 |
| 1,4,5,8-Naphthalenetetracarbondiimide | 5690-24-4 | 2A-9087195 |
| 4-(Methylsulfonamido)benzoicAcid | 7151-76-0 | 2A-9087196 |
| 4-(Methylsulfonylamino)benzylamineHydrochloride | 128263-66-1 | 2A-9087197 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA