
CAS Number539-66-2
Synonymssodium 3-methylbutanoate; sodium salt of isovaleric acid; isopentanoic acid Na-salt; 3-methylbutyric acid sodium salt; isovaleric acid sodium salt; Sodium isovalerate; EINECS 208-723-5
Molecular Formula(CH3)2CHCH213CO2Na
Molecular Weight125.11
Boiling Point175.3ºC at 760mmHg
Melting Point224-226 °C (lit.)
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 539-66-2 |
| Catalog No. | 2A-9087183 |
| Chinese Name | 異戊酸鈉 |
| Synonyms | sodium 3-methylbutanoate; sodium salt of isovaleric acid; isopentanoic acid Na-salt; 3-methylbutyric acid sodium salt; isovaleric acid sodium salt; Sodium isovalerate; EINECS 208-723-5 |
| Molecular Formula | (CH3)2CHCH213CO2Na |
| Molecular Weight | 125.11 |
| Boiling Point | 175.3ºC at 760mmHg |
| Melting Point | 224-226 °C (lit.) |
| Appearance | solid |
| HTC | 2915900090 |
| PubChem ID | 24872291 |
| MDL Number | MFCD00084070 |
| SMILES | [Na+].CC(C)C[13C]([O-])=O |
| InChI | 1S/C5H10O2.Na/c1-4(2)3-5(6)7;/h4H,3H2,1-2H3,(H,6,7);/q;+1/p-1/i5+1; |
| InChI Key | JJZAWYXASMCCLB-LJJZSEGWSA-M |
| UNSPSC | 12352202 |
| MSDS | msds/87183_1_539_66_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,7-Dimethoxynaphthalene | 5309-18-2 | 2A-9087174 |
| 2-Carbamoyl-6-nitrobenzoicAcid | 65911-46-8 | 2A-9087176 |
| 1,2,3,4,5,6,7,8-Octahydrophenanthrene | 5325-97-3 | 2A-9087177 |
| 1,2,5,6-Dibenzanthracene | 53-70-3 | 2A-9087180 |
| 2-Methoxy-6-nitrobenzoicAcid | 53967-73-0 | 2A-9087182 |
| 2-Chloro-5-fluoroisonicotinicAcid | 884494-74-0 | 2A-9087184 |
| 2-Amino-1-(4-nitro-phenyl)-ethanonehydrochloride | 5425-81-0 | 2A-9087186 |
| Sodium8-chloronaphthalene-1-sulfonate | 5439-85-0 | 2A-9087189 |
| Methyl2-Hydroxy-5-methoxybenzoate | 2905-82-0 | 2A-9087191 |
| 1,4,5,8-Naphthalenetetracarbondiimide | 5690-24-4 | 2A-9087195 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA