
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7335-27-5 |
| Catalog No. | 2A-9086958 |
| Chinese Name | 4-氯苯甲酸乙酯 |
| Synonyms | EINECS 230-844-7; Ethyl 4-chlorobenzoate; MFCD00013645; Benzoic acid, 4-chloro-, ethyl ester |
| Molecular Formula | C9H9ClO2 |
| Molecular Weight | 184.624 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 238.1±13.0 °C at 760 mmHg |
| Storage Condition | Sealed and stored in a cool, dry environment. |
| Packaging | III |
| HTC | 29339990 |
| MDL Number | MFCD00013645 |
| SMILES | CCOC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H9ClO2/c1-2-12-9(11)7-3-5-8(10)6-4-7/h3-6H,2H2,1H3 |
| InChI Key | RWBYCMPOFNRISR-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| MSDS | msds/86958_1_7335_27_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 96.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-[2-(Dimethylamino)ethoxy]-4-methoxybenzonitrile | 938239-74-8 | 2A-9086945 |
| 1-Bromo-2-fluoro-4-(methylsulfonyl)benzene | 1032825-02-7 | 2A-9086953 |
| 2,4,6-Trimethylthiophenol | 1541-10-2 | 2A-9086955 |
| 2,5-Diethyl-3,4-diphenylcyclopentadienone | 51932-77-5 | 2A-9086956 |
| 2,5-Dimethoxypropiophenone | 5803-30-5 | 2A-9086957 |
| 2,5-Dimethyl-3,4-diphenylcyclopentadienonedimer | 38883-84-0 | 2A-9086959 |
| 4-Methyl-2-nitrobenzoicacid | 27329-27-7 | 2A-9086961 |
| 2-Benzylidene-1-tetralone | 6261-32-1 | 2A-9086963 |
| 2-Bromo-1-(3-chloro-4-methylphenyl)propan-1-one | 175135-93-0 | 2A-9086964 |
| Methyl2-amino-2-benzyl-3-phenylpropanoate | 137582-40-2 | 2A-9086966 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA