
CAS Number51932-77-5
Synonyms2,5-DIETHYL-3,4-DIPHENYLCYCLOPENTADIENONE; 2,5-Diaethyl-3,4-diphenyl-cyclopentadienon; 2,5-DIETHYL-3,4-DIPHENYL-CYCLOPENTA-2,4-DIENONE; MFCD00013748; EINECS 257-523-4; 2,5-diethyl-3,4-diphenyl-cyclopentadienone
Molecular FormulaC21H20O
Molecular Weight288.393
Density1.078g/cm3
Boiling Point447.8ºC at 760 mmHg
Melting Point102-103ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51932-77-5 |
| Catalog No. | 2A-9086956 |
| Chinese Name | 2,5-二乙基-3,4-二苯基环戊二酮 |
| Synonyms | 2,5-DIETHYL-3,4-DIPHENYLCYCLOPENTADIENONE; 2,5-Diaethyl-3,4-diphenyl-cyclopentadienon; 2,5-DIETHYL-3,4-DIPHENYL-CYCLOPENTA-2,4-DIENONE; MFCD00013748; EINECS 257-523-4; 2,5-diethyl-3,4-diphenyl-cyclopentadienone |
| Molecular Formula | C21H20O |
| Molecular Weight | 288.393 |
| Density | 1.078g/cm3 |
| Boiling Point | 447.8ºC at 760 mmHg |
| Melting Point | 102-103ºC |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2914399090 |
| MDL Number | MFCD00013748 |
| SMILES | CCC1=C(c2ccccc2)C(c2ccccc2)=C(CC)C1=O |
| InChI | InChI=1S/C21H20O/c1-3-17-19(15-11-7-5-8-12-15)20(18(4-2)21(17)22)16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3 |
| InChI Key | MTZCOHPDBKHNON-UHFFFAOYSA-N |
| MSDS | msds/86956_1_51932_77_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Methyl-2-tetralone | 4024-14-0 | 2A-0201377 |
| 2,2,5,5-Tetramethyl-2,5-disila-1-oxacyclopentane | 7418-20-4 | 2A-9086944 |
| 3-[2-(Dimethylamino)ethoxy]-4-methoxybenzonitrile | 938239-74-8 | 2A-9086945 |
| 1-Bromo-2-fluoro-4-(methylsulfonyl)benzene | 1032825-02-7 | 2A-9086953 |
| 2,4,6-Trimethylthiophenol | 1541-10-2 | 2A-9086955 |
| 2,5-Dimethoxypropiophenone | 5803-30-5 | 2A-9086957 |
| Ethyl4-chlorobenzoate | 7335-27-5 | 2A-9086958 |
| 2,5-Dimethyl-3,4-diphenylcyclopentadienonedimer | 38883-84-0 | 2A-9086959 |
| 4-Methyl-2-nitrobenzoicacid | 27329-27-7 | 2A-9086961 |
| 2-Benzylidene-1-tetralone | 6261-32-1 | 2A-9086963 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA