
CAS Number1541-10-2
Synonyms2-Sulphanylmesitylene; 2-Mercaptomesitylene; 2,4,6-Trimethylthiophenol; MFCD00218475; 2,4,6-trimethylphenylthiol; 2-mesitylenethiol; 2,4,6-trimethylbenzene-1-thiol; 1,3,5-trimethylthiophenol; 2-mesitylmercaptan
Molecular FormulaC9H12S1
Molecular Weight152.26
Density1.009g/cm3
Boiling Point231.8ºC at 760mmHg
Melting Point142-143°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1541-10-2 |
| Catalog No. | 2A-9086955 |
| Chinese Name | 2,4,6-三甲基苯硫酚 |
| Synonyms | 2-Sulphanylmesitylene; 2-Mercaptomesitylene; 2,4,6-Trimethylthiophenol; MFCD00218475; 2,4,6-trimethylphenylthiol; 2-mesitylenethiol; 2,4,6-trimethylbenzene-1-thiol; 1,3,5-trimethylthiophenol; 2-mesitylmercaptan |
| Molecular Formula | C9H12S1 |
| Molecular Weight | 152.26 |
| Density | 1.009g/cm3 |
| Boiling Point | 231.8ºC at 760mmHg |
| Melting Point | 142-143°C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2930909090 |
| MDL Number | MFCD00218475 |
| SMILES | Cc1cc(C)c(S)c(C)c1 |
| InChI | InChI=1S/C9H12S/c1-6-4-7(2)9(10)8(3)5-6/h4-5,10H,1-3H3/p-1 |
| InChI Key | PKANQZUPJCMBAK-UHFFFAOYSA-N |
| MSDS | msds/86955_1_1541_10_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2930909090. other organo-sulfur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-bromo-2,3,5,6-Tetramethylbenzene | 1646-53-3 | 2A-9086940 |
| 1-Methyl-2-tetralone | 4024-14-0 | 2A-0201377 |
| 2,2,5,5-Tetramethyl-2,5-disila-1-oxacyclopentane | 7418-20-4 | 2A-9086944 |
| 3-[2-(Dimethylamino)ethoxy]-4-methoxybenzonitrile | 938239-74-8 | 2A-9086945 |
| 1-Bromo-2-fluoro-4-(methylsulfonyl)benzene | 1032825-02-7 | 2A-9086953 |
| 2,5-Diethyl-3,4-diphenylcyclopentadienone | 51932-77-5 | 2A-9086956 |
| 2,5-Dimethoxypropiophenone | 5803-30-5 | 2A-9086957 |
| Ethyl4-chlorobenzoate | 7335-27-5 | 2A-9086958 |
| 2,5-Dimethyl-3,4-diphenylcyclopentadienonedimer | 38883-84-0 | 2A-9086959 |
| 4-Methyl-2-nitrobenzoicacid | 27329-27-7 | 2A-9086961 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA