
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 207986-20-7 |
| Catalog No. | 2A-9085279 |
| Chinese Name | 3-氟-5-(三氟甲基)苯甲酰胺 |
| Synonyms | 5-fluoro-3-(trifluoromethyl)benzamide; MFCD00061149 |
| Molecular Formula | C8H5F4NO |
| Molecular Weight | 207.12500 |
| Density | 1.42g/cm3 |
| Boiling Point | 197.8ºC at 760mmHg |
| Melting Point | 115-117°C |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2924299090 |
| SMILES | NC(=O)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H5F4NO/c9-6-2-4(7(13)14)1-5(3-6)8(10,11)12/h1-3H,(H2,13,14) |
| InChI Key | BBUBHNZCRQRAQG-UHFFFAOYSA-N |
| MSDS | msds/85279_1_207986_20_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-Fluoro-3-(trifluoromethyl)benzamide | 207853-60-9 | 2A-9085270 |
| 2-Fluoro-4-(trifluoromethyl)benzamide | 207853-64-3 | 2A-9085272 |
| 2-Fluoro-5-(trifluoromethyl)benzamide | 207919-05-9 | 2A-9085274 |
| 2-Thiophen-3-yl-benzaldehyde | 99902-03-1 | 2A-9085276 |
| 2-Thien-2-ylbenzaldehyde | 99902-07-5 | 2A-9085277 |
| 4-Fluoro-2-(trifluoromethyl)benzamide | 207919-06-0 | 2A-9085280 |
| 4-Fluoro-3-(trifluoromethyl)benzamide | 67515-57-5 | 2A-9085286 |
| 2-Amino-5-chlorobenzophenoneoxime | 18097-52-4 | 2A-9085313 |
| 2-Chloro-6-trifluoromethylaniline | 433-94-3 | 2A-9085314 |
| 1,4-Bis(Dibromomethyl)benzene | 1592-31-0 | 2A-9085345 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA