
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 207853-60-9 |
| Catalog No. | 2A-9085270 |
| Chinese Name | 2-氟-3-(三氟甲基)苯甲酰胺 |
| Synonyms | MFCD00061146; 2-Fluoro-3-trifluoromethyl-benzamide |
| Molecular Formula | C14H9F4NO |
| Molecular Weight | 283.228 |
| Density | 1.42g/cm3 |
| Boiling Point | 210.9ºC at 760mmHg |
| Melting Point | 94-97 °C(lit.) |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2924299090 |
| MDL Number | MFCD00045070 |
| SMILES | NC(=O)c1cccc(C(F)(F)F)c1F |
| InChI Key | UHMUBYIIPNQHGD-UHFFFAOYSA-N |
| MSDS | msds/85270_1_207853_60_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-(Morpholinomethyl)benzaldehyde | 82413-63-6 | 2A-9085259 |
| 3-(5-Methyl-1,2,4-oxadiazol-3-yl)benzaldehyde | 852180-68-8 | 2A-9085262 |
| 3-(1H-Pyrazol-1-yl)benzaldehyde | 852227-92-0 | 2A-9085264 |
| 4-(1H-1,2,4-Triazol-1-ylmethyl)benzaldehyde | 859850-94-5 | 2A-9085265 |
| 3-(1H-1,2,4-Triazol-1-ylmethyl)benzaldehyde | 876316-30-2 | 2A-9085267 |
| 2-Fluoro-4-(trifluoromethyl)benzamide | 207853-64-3 | 2A-9085272 |
| 2-Fluoro-5-(trifluoromethyl)benzamide | 207919-05-9 | 2A-9085274 |
| 2-Thiophen-3-yl-benzaldehyde | 99902-03-1 | 2A-9085276 |
| 2-Thien-2-ylbenzaldehyde | 99902-07-5 | 2A-9085277 |
| 3-Fluoro-5-(trifluoromethyl)benzamide | 207986-20-7 | 2A-9085279 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA