
CAS Number18097-52-4
Synonyms2-Amino-5-chlor-benzophenonoxim; 2-amino-5-chloro-benzophenone oxime; MFCD00014780; (2-amino-5-chlorophenyl)(phenyl)methanoneoxime; (2-amino-5-chlorophenyl)phenyl-methanonoxime; Methanone,(2-amino-5-chlorophenyl)phenyl-,oxime; Mixtureofsyn-andanti-isomeres; 1-(2-Amino-5-chlor-phenyl)-1-phenyl-methanonoxim; 2-AMINO-5-CHLOROBENZOPHENEONE OXIME; (2-Amino-5-chlorophenyl)(phenyl)methanone oxime; EINECS 241-999-5
Molecular FormulaC13H11ClN2O
Molecular Weight246.698
Density1.27g/cm3
Boiling Point434.9ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 18097-52-4 |
| Catalog No. | 2A-9085313 |
| Chinese Name | 2-氨基-5-氯二苯酮肟 |
| Synonyms | 2-Amino-5-chlor-benzophenonoxim; 2-amino-5-chloro-benzophenone oxime; MFCD00014780; (2-amino-5-chlorophenyl)(phenyl)methanoneoxime; (2-amino-5-chlorophenyl)phenyl-methanonoxime; Methanone,(2-amino-5-chlorophenyl)phenyl-,oxime; Mixtureofsyn-andanti-isomeres; 1-(2-Amino-5-chlor-phenyl)-1-phenyl-methanonoxim; 2-AMINO-5-CHLOROBENZOPHENEONE OXIME; (2-Amino-5-chlorophenyl)(phenyl)methanone oxime; EINECS 241-999-5 |
| Molecular Formula | C13H11ClN2O |
| Molecular Weight | 246.698 |
| Density | 1.27g/cm3 |
| Boiling Point | 434.9ºC at 760mmHg |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2928000090 |
| MDL Number | MFCD00014780 |
| SMILES | Nc1ccc(Cl)cc1C(=NO)c1ccccc1 |
| InChI | InChI=1S/C13H11ClN2O/c14-10-6-7-12(15)11(8-10)13(16-17)9-4-2-1-3-5-9/h1-8,17H,15H2/b16-13+ |
| InChI Key | GCAVNCINXJNLED-UHFFFAOYSA-N |
| MSDS | msds/85313_1_18097_52_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-Thiophen-3-yl-benzaldehyde | 99902-03-1 | 2A-9085276 |
| 2-Thien-2-ylbenzaldehyde | 99902-07-5 | 2A-9085277 |
| 3-Fluoro-5-(trifluoromethyl)benzamide | 207986-20-7 | 2A-9085279 |
| 4-Fluoro-2-(trifluoromethyl)benzamide | 207919-06-0 | 2A-9085280 |
| 4-Fluoro-3-(trifluoromethyl)benzamide | 67515-57-5 | 2A-9085286 |
| 2-Chloro-6-trifluoromethylaniline | 433-94-3 | 2A-9085314 |
| 1,4-Bis(Dibromomethyl)benzene | 1592-31-0 | 2A-9085345 |
| 2,4-Pentanedionedioxime | 2157-56-4 | 2A-9085353 |
| PTH-DL-Alpha-Aminoisobutyricacid | 21083-30-7 | 2A-9085355 |
| 1,3-Bis(Dibromomethyl)benzene | 36323-28-1 | 2A-9085356 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA