
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 10541-56-7 |
| Catalog No. | 2A-9084956 |
| Chinese Name | 对辛基苯乙酮 |
| Synonyms | MFCD00043682; 1-(4-Octylphenyl)ethanone |
| Molecular Formula | C16H24O1 |
| Molecular Weight | 232.37 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 340.8±21.0 °C at 760 mmHg |
| Melting Point | 22ºC |
| Appearance | Low melting point, colorless to light yellow solid, aromatic odor |
| Storage Condition | Seal in a cool, dry place. |
| HTC | 2914399090 |
| MDL Number | MFCD00043682 |
| SMILES | CCCCCCCCc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C16H24O/c1-3-4-5-6-7-8-9-15-10-12-16(13-11-15)14(2)17/h10-13H,3-9H2,1-2H3 |
| InChI Key | GARQDIVXKVBJFP-UHFFFAOYSA-N |
| MSDS | msds/84956_1_10541_56_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,3,4,5,6-Pentamethylacetophenone | 2040-01-9 | 2A-9084947 |
| 2',4',5'-Trimethylacetophenone | 2040-07-5 | 2A-9084950 |
| 1,4-Bis(Glycidyloxy)Benzene | 2425-01-6 | 2A-9084951 |
| 2',3',4',6'-Tetramethoxyacetophenone | 7508-05-6 | 2A-9084954 |
| Bis[2-(4-Methoxyphenoxy)Ethyl]Ether | 104104-12-3 | 2A-9084955 |
| Beta-Phenylpropiophenone | 1083-30-3 | 2A-9084958 |
| 4'-Benzyloxy-2'-methoxy-3'-methylacetophenone | 118824-96-7 | 2A-9084959 |
| 1,3-Bis(4-Methoxyphenoxy)Benzene | 13118-91-7 | 2A-9084961 |
| 2-Bromo-4'-phenylacetophenone | 135-73-9 | 2A-9084962 |
| 2,4,6-Trimethylacetophenone | 1667-01-2 | 2A-9084964 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA