
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2040-01-9 |
| Catalog No. | 2A-9084947 |
| Chinese Name | 五甲基苯乙酮 |
| Synonyms | 1-pentamethylphenyl-ethanone; EINECS 218-033-6; 1-Pentamethylphenyl-aethanon; MFCD00014986; Acetylpentamethylbenzene |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.28100 |
| Density | 0.94g/cm3 |
| Boiling Point | 311.4ºC at 760mmHg |
| Melting Point | 84-86 °C(lit.) |
| Storage Condition | Keep the receptacle sealed and stored in a cool, d |
| HTC | 2914399090 |
| SMILES | CC(=O)c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C13H18O/c1-7-8(2)10(4)13(12(6)14)11(5)9(7)3/h1-6H3 |
| InChI Key | CTTYWXDVWGKHKJ-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Isothiocyanato-4'-nitrodiphenylsulfide | 19822-35-6 | 2A-9084933 |
| 2-(4-Methoxyphenoxy)ethanethioamide | 35370-92-4 | 2A-9084934 |
| 2-(4-Methoxyphenoxy)Acetamide | 30893-64-2 | 2A-9084936 |
| 3-Amino-4-(4MethoxyphenoxyBenzotrifluoride | 62966-74-9 | 2A-9084937 |
| 2-(2-Methoxyphenoxy)Acetamide | 183427-87-4 | 2A-9084939 |
| 2',4',5'-Trimethylacetophenone | 2040-07-5 | 2A-9084950 |
| 1,4-Bis(Glycidyloxy)Benzene | 2425-01-6 | 2A-9084951 |
| 2',3',4',6'-Tetramethoxyacetophenone | 7508-05-6 | 2A-9084954 |
| Bis[2-(4-Methoxyphenoxy)Ethyl]Ether | 104104-12-3 | 2A-9084955 |
| 4'-n-Octylacetophenone | 10541-56-7 | 2A-9084956 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA