
CAS Number2425-01-6
Synonyms1,4-bis(oxiran-2-ylmethoxy)benzene; 2,2'-p-phenylenedioxydimethyl-bis-oxirane; diglycidyl resorcinol ether; MFCD00186891; F0777-0005; 1,4-bis-oxiranylmethoxy-benzene; Hydroquinone diglycidyl ether; Hydroquinone 1,4-diglycidyl ether; 1,4-bis(2,3-epoxypropoxy)benzene; 1,4-Bis-(2,3-epoxy-propoxy)-benzol; 1,4-bis(2',3'-epoxypropyloxy)benzene
Molecular FormulaC12H14O4
Molecular Weight222.24
Density1.248g/cm3
Boiling Point366.2ºC at 760mmHg
Melting Point110-112°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2425-01-6 |
| Catalog No. | 2A-9084951 |
| Chinese Name | 1,4-双(氧化缩水甘油)苯 |
| Synonyms | 1,4-bis(oxiran-2-ylmethoxy)benzene; 2,2'-p-phenylenedioxydimethyl-bis-oxirane; diglycidyl resorcinol ether; MFCD00186891; F0777-0005; 1,4-bis-oxiranylmethoxy-benzene; Hydroquinone diglycidyl ether; Hydroquinone 1,4-diglycidyl ether; 1,4-bis(2,3-epoxypropoxy)benzene; 1,4-Bis-(2,3-epoxy-propoxy)-benzol; 1,4-bis(2',3'-epoxypropyloxy)benzene |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 |
| Density | 1.248g/cm3 |
| Boiling Point | 366.2ºC at 760mmHg |
| Melting Point | 110-112°C |
| Storage Condition | Keep container sealed, placed in a tight-fitting c |
| HTC | 2910900090 |
| MDL Number | MFCD00186891 |
| SMILES | c1cc(OCC2CO2)ccc1OCC1CO1 |
| InChI | InChI=1S/C12H14O4/c1-2-10(14-6-12-8-16-12)4-3-9(1)13-5-11-7-15-11/h1-4,11-12H,5-8H2 |
| InChI Key | FSYPIGPPWAJCJG-UHFFFAOYSA-N |
| MSDS | msds/84951_1_2425_01_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2910900090. epoxides, epoxyalcohols, epoxyphenols and epoxyethers, with a three-membered ring, and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(4-Methoxyphenoxy)Acetamide | 30893-64-2 | 2A-9084936 |
| 3-Amino-4-(4MethoxyphenoxyBenzotrifluoride | 62966-74-9 | 2A-9084937 |
| 2-(2-Methoxyphenoxy)Acetamide | 183427-87-4 | 2A-9084939 |
| 2,3,4,5,6-Pentamethylacetophenone | 2040-01-9 | 2A-9084947 |
| 2',4',5'-Trimethylacetophenone | 2040-07-5 | 2A-9084950 |
| 2',3',4',6'-Tetramethoxyacetophenone | 7508-05-6 | 2A-9084954 |
| Bis[2-(4-Methoxyphenoxy)Ethyl]Ether | 104104-12-3 | 2A-9084955 |
| 4'-n-Octylacetophenone | 10541-56-7 | 2A-9084956 |
| Beta-Phenylpropiophenone | 1083-30-3 | 2A-9084958 |
| 4'-Benzyloxy-2'-methoxy-3'-methylacetophenone | 118824-96-7 | 2A-9084959 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA