
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 712-24-3 |
| Catalog No. | 2A-9084606 |
| Chinese Name | 3-硝基苯胺-4-磺酸 |
| Synonyms | EINECS 211-920-9; 4-amino-2-nitrobenzenesulfonic acid; MFCD00059185 |
| Molecular Formula | C6H6N2O5S |
| Molecular Weight | 218.189 |
| Density | 1.727 g/cm3 |
| Appearance | Solid;Light yellow to Brown to Dark green powder to crystal |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| HTC | 2921420090 |
| MDL Number | MFCD00059185 |
| SMILES | Nc1ccc(S(=O)(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H6N2O5S/c7-4-1-2-6(14(11,12)13)5(3-4)8(9)10/h1-3H,7H2,(H,11,12,13) |
| InChI Key | ZNMGCJDUZADKPW-UHFFFAOYSA-N |
| MSDS | msds/84606_1_712_24_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 94.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-(8-Bromooctyl)phthalimide | 17702-83-9 | 2A-9084599 |
| 4,4',4''-TRIMETHOXYTRITYL ALCOHOL | 3010-81-9 | 2A-9084600 |
| 2-Amino-2-methyl-butyrichydrochloride | 595-39-1 | 2A-9084601 |
| N-(5-Bromopentyl)phthalimide | 954-81-4 | 2A-9084602 |
| 1-(4-Bromophenyl)imidazoline-2-thione | 17452-23-2 | 2A-9084605 |
| 2,3,4-Trimethyl-3-pentanol | 3054-92-0 | 2A-9084607 |
| N1-Isopropyl-4-chloro-2-nitroaniline | 89659-66-5 | 2A-9084608 |
| N-(2,4,6-Trimethylphenyl)thiourea | 91059-97-1 | 2A-9084609 |
| 3-Chloro-4-nitroaniline | 825-41-2 | 2A-9084610 |
| Bis(3-bromo-1,2,4-thiadiazol-5-ylthio)methane | 444791-14-4 | 2A-9084611 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA