
CAS Number954-81-4
Synonyms2-(5-bromopentyl)isoindole-1,3-dione; 2-(5-Bromopentyl)-1H-isoindole-1,3(2H)-dione; MFCD00060522
Molecular FormulaC13H14BrNO2
Molecular Weight296.16
Purity95%
Density1.5±0.1 g/cm3
Boiling Point393.1±25.0 °C at 760 mmHg
Melting Point59-64 °C
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 954-81-4 |
| Catalog No. | 2A-9084602 |
| Chinese Name | N-(5-溴戊基)酞亚胺 |
| Synonyms | 2-(5-bromopentyl)isoindole-1,3-dione; 2-(5-Bromopentyl)-1H-isoindole-1,3(2H)-dione; MFCD00060522 |
| Molecular Formula | C13H14BrNO2 |
| Molecular Weight | 296.16 |
| Purity | 95 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 393.1±25.0 °C at 760 mmHg |
| Melting Point | 59-64 °C |
| Appearance | solid |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| HTC | 2925190090 |
| PubChem ID | 329763933 |
| MDL Number | MFCD00060522 |
| SMILES | BrCCCCCN1C(=O)c2ccccc2C1=O |
| InChI | 1S/C13H14BrNO2/c14-8-4-1-5-9-15-12(16)10-6-2-3-7-11(10)13(15)17/h2-3,6-7H,1,4-5,8-9H2 |
| InChI Key | QKVHAKICMNABGB-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/84602_1_954_81_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Amino-3-methylbutyricacid | 386715-46-4 | 2A-9084597 |
| 2-Amino-2-methyl-butyricacidmethylesterhydrochloride | 156032-14-3 | 2A-9084598 |
| N-(8-Bromooctyl)phthalimide | 17702-83-9 | 2A-9084599 |
| 4,4',4''-TRIMETHOXYTRITYL ALCOHOL | 3010-81-9 | 2A-9084600 |
| 2-Amino-2-methyl-butyrichydrochloride | 595-39-1 | 2A-9084601 |
| 1-(4-Bromophenyl)imidazoline-2-thione | 17452-23-2 | 2A-9084605 |
| 3-Nitroaniline-4-sulfonicacid | 712-24-3 | 2A-9084606 |
| 2,3,4-Trimethyl-3-pentanol | 3054-92-0 | 2A-9084607 |
| N1-Isopropyl-4-chloro-2-nitroaniline | 89659-66-5 | 2A-9084608 |
| N-(2,4,6-Trimethylphenyl)thiourea | 91059-97-1 | 2A-9084609 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA