
CAS Number17702-83-9
SynonymsN-8-bromooctylphthalimide; 2-(8-Bromooctyl)isoindoline-1,3-dione; MFCD00060523
Molecular FormulaC16H20BrNO2
Molecular Weight338.24000
Density1.34g/cm3
Boiling Point429.7ºC at 760mmHg
Melting Point49-56ºC
AppearanceWhite to beige or light brown crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17702-83-9 |
| Catalog No. | 2A-9084599 |
| Chinese Name | 2-(8-溴乙基)异二氢吲哚-1,3-二酮 |
| Synonyms | N-8-bromooctylphthalimide; 2-(8-Bromooctyl)isoindoline-1,3-dione; MFCD00060523 |
| Molecular Formula | C16H20BrNO2 |
| Molecular Weight | 338.24000 |
| Density | 1.34g/cm3 |
| Boiling Point | 429.7ºC at 760mmHg |
| Melting Point | 49-56ºC |
| Appearance | White to beige or light brown crystalline powder |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2925190090 |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCCCCCBr |
| InChI | InChI=1S/C16H20BrNO2/c17-11-7-3-1-2-4-8-12-18-15(19)13-9-5-6-10-14(13)16(18)20/h5-6,9-10H,1-4,7-8,11-12H2 |
| InChI Key | LAMUQORCSIHVMC-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,3,4-Trimethoxybenzonitrile | 43020-38-8 | 2A-9084589 |
| 2-(6-Amino-4-oxo-1,4-dihydro-pyrimidin-2-yl-sufanyl)butyricacid | 436088-62-9 | 2A-9084590 |
| 2-[(6-Amino-9H-Purin-8-yl)thio]butanoicacid | 436086-77-0 | 2A-9084595 |
| 3-Amino-3-methylbutyricacid | 386715-46-4 | 2A-9084597 |
| 2-Amino-2-methyl-butyricacidmethylesterhydrochloride | 156032-14-3 | 2A-9084598 |
| 4,4',4''-TRIMETHOXYTRITYL ALCOHOL | 3010-81-9 | 2A-9084600 |
| 2-Amino-2-methyl-butyrichydrochloride | 595-39-1 | 2A-9084601 |
| N-(5-Bromopentyl)phthalimide | 954-81-4 | 2A-9084602 |
| 1-(4-Bromophenyl)imidazoline-2-thione | 17452-23-2 | 2A-9084605 |
| 3-Nitroaniline-4-sulfonicacid | 712-24-3 | 2A-9084606 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA