
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 41772-23-0 |
| Catalog No. | 2A-9084375 |
| Chinese Name | 2-氨基-1-萘酚盐酸盐 |
| Synonyms | 2-Amino-1-Naphthol Hydrochloride; MFCD00050530; 2-aminonaphthalen-1-ol,hydrochloride; EINECS 255-548-5 |
| Molecular Formula | C10H10O1N1Cl1 |
| Molecular Weight | 195.65 |
| Boiling Point | 343.5ºC at 760mmHg |
| Storage Condition | Warehouse ventilation and low temperature drying |
| HTC | 2922299090 |
| MDL Number | MFCD00050530 |
| SMILES | Cl.Nc1ccc2ccccc2c1O |
| InChI | InChI=1S/C10H9NO.ClH/c11-9-6-5-7-3-1-2-4-8(7)10(9)12;/h1-6,12H,11H2;1H |
| InChI Key | PEJOQASNBCUDMB-UHFFFAOYSA-N |
| MSDS | msds/84375_1_41772_23_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-(6-Aminohexyl)-1-naphthalenesulfonamideHCl | 61714-25-8 | 2A-9084365 |
| N-(4-Aminobutyl)-2-naphthalenesulfonamideHCl | 89108-46-3 | 2A-9084368 |
| N-(4-Aminobutyl)-5-chloro-1-naphthalenesulfonamideHCl | 78957-84-3 | 2A-9084369 |
| N-(5-Aminopentyl)-5-chloro-1-naphthalene-sulfonamidehydrochloride | 61714-24-7 | 2A-9084371 |
| 1-Amino-2-methylnaphthalene | 2246-44-8 | 2A-9084373 |
| 6-Amino-1-naphthol | 23894-12-4 | 2A-0201855 |
| N-Acetyl-gly-lysmethylesteracetatesalt | 14752-92-2 | 2A-9084377 |
| 4-Amino-3-nitro-acetophenone | 1432-42-4 | 2A-9084378 |
| 2-Aminochrysene | 789-47-9 | 2A-9084382 |
| 4'-Formylacetanilidthiosemicarbazon | 104-06-3 | 2A-9084384 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA