
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1432-42-4 |
| Catalog No. | 2A-9084378 |
| Chinese Name | 4-氨基-3-硝基苯乙酮 |
| Synonyms | Exact Mass 180.05300; PSA 88.91000; LogP 2.48400; Index of Refraction 1.614; InChIKey VEIXVSPCPGWULB-UHFFFAOYSA-N |
| Molecular Formula | C14H11N3O3 |
| Molecular Weight | 269.262 |
| Density | 1.334g/cm3 |
| Boiling Point | 336.898ºC at 760 mmHg |
| Melting Point | 148-149°C (lit.) |
| Storage Condition | 2-8°C, dry |
| HTC | 2922399090 |
| MDL Number | MFCD00768885 |
| SMILES | CC(=O)c1ccc(N)c([N+](=O)[O-])c1 |
| InChI Key | VEIXVSPCPGWULB-UHFFFAOYSA-N |
| MSDS | msds/84378_1_1432_42_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-(5-Aminopentyl)-5-chloro-1-naphthalene-sulfonamidehydrochloride | 61714-24-7 | 2A-9084371 |
| 1-Amino-2-methylnaphthalene | 2246-44-8 | 2A-9084373 |
| 2-Amino-1-naphtholhydrochloride | 41772-23-0 | 2A-9084375 |
| 6-Amino-1-naphthol | 23894-12-4 | 2A-0201855 |
| N-Acetyl-gly-lysmethylesteracetatesalt | 14752-92-2 | 2A-9084377 |
| 2-Aminochrysene | 789-47-9 | 2A-9084382 |
| 4'-Formylacetanilidthiosemicarbazon | 104-06-3 | 2A-9084384 |
| 3-Methoxyacetoacetanilide | 25233-47-0 | 2A-9084388 |
| Diethyl(4-nitrobenzyl)phosphonate | 2609-49-6 | 2A-9084389 |
| 4-Acetylacetanilide | 2719-21-3 | 2A-9084391 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA