CAS Number5386-30-1
Synonyms1-heptafluoronaphthol; 2,3,4,5,6,7,8-HEPTAFLUORONAPHTHALENE-1-OL; 1-Perfluoronaphthol; perfluoronaphthol-1; heptafluoro-1-naphthol; heptafluoro-1-naphthole
Molecular FormulaC10HF7O
Molecular Weight270.10300
Density1.783 g/cm3
Boiling Point306.9ºC at 760 mmHg
Melting Point103-107ºC
AppearanceLight brown crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5386-30-1 |
| Catalog No. | 2A-9083951 |
| Chinese Name | Alpha-羟基-七氟萘 |
| Synonyms | 1-heptafluoronaphthol; 2,3,4,5,6,7,8-HEPTAFLUORONAPHTHALENE-1-OL; 1-Perfluoronaphthol; perfluoronaphthol-1; heptafluoro-1-naphthol; heptafluoro-1-naphthole |
| Molecular Formula | C10HF7O |
| Molecular Weight | 270.10300 |
| Density | 1.783 g/cm3 |
| Boiling Point | 306.9ºC at 760 mmHg |
| Melting Point | 103-107ºC |
| Appearance | Light brown crystalline powder |
| Storage Condition | Store airtight in a cool, dry warehouse. |
| HTC | 2908199090 |
| SMILES | Oc1c(F)c(F)c(F)c2c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C10HF7O/c11-3-1-2(5(13)7(15)6(3)14)10(18)9(17)8(16)4(1)12/h18H |
| InChI Key | ODAJDDMWMREWGL-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,4-(Methylenedioxy)propiophenone | 28281-49-4 | 2A-9083939 |
| 3-Chloropropyl2-thienylketone | 43076-59-1 | 2A-9083942 |
| 3-Ethyl-3-methylglutarimide | 64-65-3 | 2A-9083943 |
| 2-(1,1,2,2-Tetrafluoroethoxy)naphthalene | 2796-08-9 | 2A-9083946 |
| 5-Dimethylaminonaphthalene-1-sulfonylfluoride | 34523-28-9 | 2A-9083948 |
| 4,5-Dimethyl-2-furoicacidethylester | 119155-04-3 | 2A-9083952 |
| Heptafluoro-2-naphthol | 727-49-1 | 2A-9083953 |
| 2-(2-Hydroxy-1,1,1,3,3,3-hexafluoropropyl)-1-naphthol | 2092-87-7 | 2A-9083955 |
| 2-Fluoro-1-naphthol | 56874-95-4 | 2A-9083956 |
| 4,7-Dimethoxy-5-(2-propanyl)-1,3-benzodioxole | 523-80-8 | 2A-9083957 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS