
CAS Number28281-49-4
Synonyms3′,4′-(Methylenedioxy)propiophenone; 3',4'-Methylenedioxypropiophenone; 5-propionyl-1,3-benzodioxole; 1-(Benzo[d][1,3]dioxol-5-yl)propan-1-one; MFCD00016652; EINECS 248-937-6
Molecular FormulaC10H10O3
Molecular Weight178.18500
Density1,21 g/cm3
Boiling Point165-168°C 20mm
Melting Point34-36°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 28281-49-4 |
| Catalog No. | 2A-9083939 |
| Chinese Name | 3,4-(亚甲基二氧)苯丙酮 |
| Synonyms | 3′,4′-(Methylenedioxy)propiophenone; 3',4'-Methylenedioxypropiophenone; 5-propionyl-1,3-benzodioxole; 1-(Benzo[d][1,3]dioxol-5-yl)propan-1-one; MFCD00016652; EINECS 248-937-6 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.18500 |
| Density | 1,21 g/cm3 |
| Boiling Point | 165-168°C 20mm |
| Melting Point | 34-36°C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2932999099 |
| SMILES | CCC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H10O3/c1-2-8(11)7-3-4-9-10(5-7)13-6-12-9/h3-5H,2,6H2,1H3 |
| InChI Key | RVBJGSPBFIUTTR-UHFFFAOYSA-N |
| MSDS | msds/83939_1_28281_49_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Fluoro-4'-hydroxybenzophenone | 101969-75-9 | 2A-9083927 |
| 2-chloro-N-(2-furylmethyl)acetamide | 40914-13-4 | 2A-9083930 |
| Potassium4-fluorophenyltrifluoroborate | 192863-35-7 | 2A-9083934 |
| 4-Bromophenacyltriflate | 93128-04-2 | 2A-9083936 |
| 3-(4-Morpholino)propiophenonehydrochloride | 1020-16-2 | 2A-9083937 |
| 3-Chloropropyl2-thienylketone | 43076-59-1 | 2A-9083942 |
| 3-Ethyl-3-methylglutarimide | 64-65-3 | 2A-9083943 |
| 2-(1,1,2,2-Tetrafluoroethoxy)naphthalene | 2796-08-9 | 2A-9083946 |
| 5-Dimethylaminonaphthalene-1-sulfonylfluoride | 34523-28-9 | 2A-9083948 |
| Alpha-hydronyheptafluoronaphthalene | 5386-30-1 | 2A-9083951 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA