
CAS Number60563-13-5
Synonyms(4-hydroxy-3-methoxy-phenyl)-acetic acid ethyl ester; 4-Hydroxy-3-Methoxy-Benzeneacetic Acid Ethyl Ester; EINECS 262-298-0; MFCD00009180; ethyl-2-(4-hydroxy-3-methoxyphenyl)acetate; Ethyl homovanillate; Ethyl 4-hydroxy-3-methoxyphenylacetate; 3-methoxy-4-hydroxybenzeneacetic acid ethyl ester; ethyl 3-methoxy-4-hydroxyphenylacetate
Molecular FormulaHOC6H3(OCH3)CH2CO2C2H5
Molecular Weight210.23
Purity≥95%
Density1.16g/cm3
Boiling Point180-185 °C/14 mmHg (lit.)
Melting Point44-47 °C (lit.)
AppearanceWhite to light yellow crystalline powder
EINECS262-298-0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 60563-13-5 |
| Catalog No. | 2A-9081579 |
| Chinese Name | 高香兰酸乙酯 |
| Synonyms | (4-hydroxy-3-methoxy-phenyl)-acetic acid ethyl ester; 4-Hydroxy-3-Methoxy-Benzeneacetic Acid Ethyl Ester; EINECS 262-298-0; MFCD00009180; ethyl-2-(4-hydroxy-3-methoxyphenyl)acetate; Ethyl homovanillate; Ethyl 4-hydroxy-3-methoxyphenylacetate; 3-methoxy-4-hydroxybenzeneacetic acid ethyl ester; ethyl 3-methoxy-4-hydroxyphenylacetate |
| Molecular Formula | HOC6H3(OCH3)CH2CO2C2H5 |
| Molecular Weight | 210.23 |
| Purity | ≥95 |
| Density | 1.16g/cm3 |
| Boiling Point | 180-185 °C/14 mmHg (lit.) |
| Melting Point | 44-47 °C (lit.) |
| Appearance | White to light yellow crystalline powder |
| Storage Condition | Keep receptacles sealed Place in a tight container |
| EINECS | 262-298-0 |
| HTC | 2918990090 |
| MDL Number | MFCD00009180 |
| SMILES | CCOC(=O)Cc1ccc(O)c(OC)c1 |
| InChI | 1S/C11H14O4/c1-3-15-11(13)7-8-4-5-9(12)10(6-8)14-2/h4-6,12H,3,7H2,1-2H3 |
| InChI Key | AWPMWZHWVKXADV-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12164502 |
| MSDS | msds/81579_2_60563_13_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Brazilin | 474-07-7 | 2A-9081571 |
| 1-(2-Bromonaphthalen-1-yl)naphthalen-2-ol | 721457-68-7 | 2A-9081574 |
| 2,3,4,5-Tetrahydro-1H-2-benzazepinehydrochloride | 7216-22-0 | 2A-9081575 |
| 4-Chloro-3-nitrobenzylalcohol | 55912-20-4 | 2A-9081576 |
| 5-Hydroxy-2-nitrobenzylalcohol | 60463-12-9 | 2A-9081577 |
| 6,7-Dihydroxycoumeranone | 6272-27-1 | 2A-9081580 |
| (3-Methoxy-4-sulfonyloxyphenyl)glycolpotassiumsalt | 71324-20-4 | 2A-9081581 |
| 5-Chloro-2-nitrobenzylalcohol | 73033-58-6 | 2A-9081582 |
| 3,5-Dintro-4-HydroxybenzenesulfonicAcidPotassiumSalt | 74525-39-6 | 2A-9081584 |
| 3-Methyl-4-nitrobenzylalcohol | 80866-75-7 | 2A-9081587 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA