
CAS Number474-07-7
Synonyms(6aS-cis)-7,11b-Dihydrobenz[b]indeno[1,2-d]pyran-3,6a,9,10(6H)-tetrol; superbresiline; pernambucoextract; (+)-brazilin; (6aS,11bR)-7,11b-Dihydroindeno[2,1-c]chromene-3,6a,9,10(6H)-tetrol; braziletto; C.I. Natural Red 24; hypernicextract; limawoodextract; BRAZILIN; brasilin
Molecular FormulaC16H14O5
Molecular Weight286.28
Density1.6±0.1 g/cm3
Boiling Point555.8±50.0 °C at 760 mmHg
Melting Point156-157ºC
EINECS207-477-6
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 474-07-7 |
| Catalog No. | 2A-9081571 |
| Chinese Name | 巴西苏木素; 苏枋精 |
| Synonyms | (6aS-cis)-7,11b-Dihydrobenz[b]indeno[1,2-d]pyran-3,6a,9,10(6H)-tetrol; superbresiline; pernambucoextract; (+)-brazilin; (6aS,11bR)-7,11b-Dihydroindeno[2,1-c]chromene-3,6a,9,10(6H)-tetrol; braziletto; C.I. Natural Red 24; hypernicextract; limawoodextract; BRAZILIN; brasilin |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 555.8±50.0 °C at 760 mmHg |
| Melting Point | 156-157ºC |
| Storage Condition | This product should be sealed and stored away from |
| Application | Brazilin is a red dye precursor derived from the heartwood of several tropical hardwood species. Brazilin inhibits cell proliferation, promotes apoptosis and induces autophagy through the AMPK/mTOR pa |
| EINECS | 207-477-6 |
| MDL Number | MFCD00210817 |
| SMILES | O1C[C@]2([C@@H](c4c1cc(cc4)O)c3c(cc(c(c3)O)O)C2)O |
| InChI | 1S/C16H14O5/c17-9-1-2-10-14(4-9)21-7-16(20)6-8-3-12(18)13(19)5-11(8)15(10)16/h1-5,15,17-20H,6-7H2/t15-,16+/m0/s1 |
| InChI Key | UWHUTZOCTZJUKC-JKSUJKDBSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/81571_1_474_07_7.pdf |
| Transport Info | Product name: Brazilin |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Dihydroabietylalcohol | 26266-77-3 | 2A-9081564 |
| 1,3-Benzodioxole-5-glycolicacid | 27738-46-1 | 2A-9081565 |
| 2-(Hydroxymethyl)-4-nitrobenzenol | 39224-61-8 | 2A-9081567 |
| 4-Methyl-3-nitrobenzylalcohol | 40870-59-5 | 2A-9081568 |
| Piperoin | 4720-82-5 | 2A-9081570 |
| 1-(2-Bromonaphthalen-1-yl)naphthalen-2-ol | 721457-68-7 | 2A-9081574 |
| 2,3,4,5-Tetrahydro-1H-2-benzazepinehydrochloride | 7216-22-0 | 2A-9081575 |
| 4-Chloro-3-nitrobenzylalcohol | 55912-20-4 | 2A-9081576 |
| 5-Hydroxy-2-nitrobenzylalcohol | 60463-12-9 | 2A-9081577 |
| 4-Hydroxy-3-methoxyphenylaceticacidethylester | 60563-13-5 | 2A-9081579 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA