
CAS Number55912-20-4
Synonyms4-chloro-3-nitro-benzyl alcohol; 3-Hydroxymethyl-6-chloronitrobenzene; RARECHEM AL BD 0170; 3-Nitro-4-chlorobenzenemethanol; 3-Nitro-4-chlorobenzyl alcohol; 4-chloro-3-nitrobenzyl alchohol; MFCD00007086; 1-Chloro-4-hydroxymethyl-2-nitrobenzene; (4-chloro-3-nitrophenyl)-methanol; EINECS 259-901-4
Molecular Formula4-(Cl)-3-(CH3)C6H3OH
Molecular Weight142.58
Purity≥99.0 (GC)%
Density1.476g/cm3
Boiling Point235-239 °C/1013 hPa
Melting Point63-65 °C
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 55912-20-4 |
| Catalog No. | 2A-9081576 |
| Chinese Name | 4-氯-3-硝基苯甲醇 |
| Synonyms | 4-chloro-3-nitro-benzyl alcohol; 3-Hydroxymethyl-6-chloronitrobenzene; RARECHEM AL BD 0170; 3-Nitro-4-chlorobenzenemethanol; 3-Nitro-4-chlorobenzyl alcohol; 4-chloro-3-nitrobenzyl alchohol; MFCD00007086; 1-Chloro-4-hydroxymethyl-2-nitrobenzene; (4-chloro-3-nitrophenyl)-methanol; EINECS 259-901-4 |
| Molecular Formula | 4-(Cl)-3-(CH3)C6H3OH |
| Molecular Weight | 142.58 |
| Purity | ≥99.0 (GC) |
| Density | 1.476g/cm3 |
| Boiling Point | 235-239 °C/1013 hPa |
| Melting Point | 63-65 °C |
| Appearance | powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2906299090 |
| MDL Number | MFCD00002323 |
| SMILES | Clc1c(cc(cc1)O)C |
| InChI | 1S/C7H7ClO/c1-5-4-6(9)2-3-7(5)8/h2-4,9H,1H3 |
| InChI Key | CFKMVGJGLGKFKI-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352104 |
| MSDS | msds/81576_1_55912_20_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Methyl-3-nitrobenzylalcohol | 40870-59-5 | 2A-9081568 |
| Piperoin | 4720-82-5 | 2A-9081570 |
| Brazilin | 474-07-7 | 2A-9081571 |
| 1-(2-Bromonaphthalen-1-yl)naphthalen-2-ol | 721457-68-7 | 2A-9081574 |
| 2,3,4,5-Tetrahydro-1H-2-benzazepinehydrochloride | 7216-22-0 | 2A-9081575 |
| 5-Hydroxy-2-nitrobenzylalcohol | 60463-12-9 | 2A-9081577 |
| 4-Hydroxy-3-methoxyphenylaceticacidethylester | 60563-13-5 | 2A-9081579 |
| 6,7-Dihydroxycoumeranone | 6272-27-1 | 2A-9081580 |
| (3-Methoxy-4-sulfonyloxyphenyl)glycolpotassiumsalt | 71324-20-4 | 2A-9081581 |
| 5-Chloro-2-nitrobenzylalcohol | 73033-58-6 | 2A-9081582 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA