![2-[(2,6-Dichlorobenzyl)oxy]benzaldehyde structure, CAS 175203-16-4](/structures/100000/80652_1_175203_16_4.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 175203-16-4 |
| Catalog No. | 2A-9080652 |
| Chinese Name | 2-[(2,6-二氯苄基)氧基]苯甲醛 |
| Synonyms | 2-(2,6-dichlorobenzyloxy)benzaldehyde |
| Molecular Formula | C14H10Cl2O2 |
| Molecular Weight | 281.13 |
| Density | 1.34g/cm3 |
| Boiling Point | 413.4ºC at 760 mmHg |
| Melting Point | 109ºC |
| Appearance | solid |
| HTC | 2913000090 |
| PubChem ID | 329819211 |
| MDL Number | MFCD01025492 |
| SMILES | Clc1c(ccc(c1)Cl)COc2c(cccc2)C=O |
| InChI | 1S/C14H10Cl2O2/c15-12-6-5-11(13(16)7-12)9-18-14-4-2-1-3-10(14)8-17/h1-8H,9H2 |
| InChI Key | DRVFYNTWCAHSSS-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| (2-Formyl-4,5-methylenedioxy)benzeneboronicacid | 94838-88-7 | 2A-9080647 |
| 3',4'-(Didodecyloxy)benzaldehyde | 117241-25-5 | 2A-9080648 |
| 3',4'-(Didecyloxy)benzaldehyde | 118468-34-1 | 2A-9080649 |
| 3',4'-(Dioctyloxy)benzaldehyde | 131525-50-3 | 2A-9080650 |
| 4-Benzyloxy-3,5-dimethylbenzaldehyde | 144896-51-5 | 2A-9080651 |
| 4-Hex-1-Ynylbenzaldehyde | 175203-90-4 | 2A-9080653 |
| 5-Nitro-2-(2-pyridylithio)benzaldehyde | 175278-54-3 | 2A-9080654 |
| 2-Hydroxy-5-chloromethylbenzaldehyde | 23731-06-8 | 2A-9080656 |
| 3,5-Dibromo-4-[(2-chlorobenzyl)oxy]benzaldehyde | 261633-40-3 | 2A-9080657 |
| 4-(Cyclohexylthio)-3-nitrobenzaldehyde | 270262-95-8 | 2A-9080658 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA